CAS 561314-57-6

2,8-diazaspiro[4.5]decan-3-one

Description:

2,8-Diazaspiro[4.5]decan-3-one is a bicyclic compound characterized by its unique spiro structure, which consists of two nitrogen atoms incorporated into a decanone framework. This compound features a spiro connection between two rings, contributing to its distinct three-dimensional shape. The presence of the carbonyl group (ketone) at the 3-position plays a crucial role in its reactivity and potential applications in organic synthesis. The nitrogen atoms in the structure can participate in various chemical reactions, making it a versatile intermediate in the synthesis of more complex molecules. Additionally, the compound may exhibit interesting biological activities, which can be explored for pharmaceutical applications. Its relatively complex structure may also influence its physical properties, such as solubility and melting point, which are essential for understanding its behavior in different environments. Overall, 2,8-diazaspiro[4.5]decan-3-one represents a fascinating subject for research in both synthetic and medicinal chemistry.

Formula: C₈H₁₄N₂O

InChI: InChI=1/C8H14N2O/c11-7-5-8(6-10-7)1-3-9-4-2-8/h9H,1-6H2,(H,10,11)

SMILES: C1CNCCC21CC(=NC2)O

Synonyms:

• 2,8-Diazaspiro[4.5]decan-3-on
• 2,8-Diazaspiro[4,5]Decan-3-One

2,8-Diazaspiro[4.5]decan-3-one

CAS: 561314-57-6

Formula: C₈H₁₄N₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 154.2096

Ref: IN-DA00DBL7

2,8-Diazaspiro[4.5]decan-3-one

CAS: 561314-57-6

2,8-Diazaspiro[4.5]decan-3-one

Purity: 95%

Color and Shape: Solid

Molecular weight: 154.21g/mol

Ref: 54-OR52408

2,8-Diazaspiro[4.5]decan-3-one

CAS: 561314-57-6

Formula: C₈H₁₄N₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 154.213

Ref: 10-F236914