CAS 56136-79-9
:1-chloro-2-methyl-4,5-dinitrobenzene
Description:
1-Chloro-2-methyl-4,5-dinitrobenzene is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a chlorine atom, a methyl group, and two nitro groups. The presence of these functional groups imparts distinct chemical properties to the compound. The chlorine atom is an electron-withdrawing group, which can influence the reactivity of the aromatic system, while the nitro groups are strong electron-withdrawing groups that enhance the compound's electrophilic character. This compound is typically a yellow solid at room temperature and is known for its potential applications in the synthesis of dyes, pharmaceuticals, and other organic compounds. It is important to handle this substance with care due to its potential toxicity and environmental impact. Additionally, it may exhibit explosive properties under certain conditions, necessitating proper storage and handling protocols. Overall, 1-chloro-2-methyl-4,5-dinitrobenzene is a significant compound in organic chemistry with various industrial applications.
Formula:C7H5ClN2O4
InChI:InChI=1/C7H5ClN2O4/c1-4-2-6(9(11)12)7(10(13)14)3-5(4)8/h2-3H,1H3
SMILES:Cc1cc(c(cc1Cl)N(=O)=O)N(=O)=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Chloro-4,5-dinitro-toluene
CAS:Controlled ProductApplications 2-Chloro-4,5-dinitro-toluene (cas# 56136-79-9) is a compound useful in organic synthesis.
Formula:C7H5ClN2O4Color and Shape:Off-White To Light YellowMolecular weight:216.58
