CAS 56144-08-2
:2-O-Methyl-β-neuraminic acid
Description:
2-O-Methyl-β-neuraminic acid is a derivative of neuraminic acid, which is a nine-carbon sugar acid and a component of sialic acids. This compound features a methyl group at the 2-position of the neuraminic acid structure, which influences its biochemical properties and interactions. It is characterized by its role in cellular recognition processes, particularly in the context of viral infections and cell signaling. The presence of the methyl group can affect the compound's solubility, stability, and reactivity compared to its parent neuraminic acid. 2-O-Methyl-β-neuraminic acid is often studied for its potential implications in immunology and virology, as it may modulate the binding affinity of pathogens to host cells. Additionally, it can be involved in various biochemical pathways, including those related to glycoprotein synthesis. As with many sialic acids, it may also play a role in the regulation of cellular interactions and immune responses. Overall, this compound is significant in both biological research and potential therapeutic applications.
Formula:C10H19NO8
InChI:InChI=1S/C10H19NO8/c1-18-10(9(16)17)2-4(13)6(11)8(19-10)7(15)5(14)3-12/h4-8,12-15H,2-3,11H2,1H3,(H,16,17)/t4-,5+,6+,7+,8+,10-/m0/s1
InChI key:InChIKey=OMVQZDUAKZZNEF-APDUKXCWSA-N
SMILES:C(O)(=O)[C@@]1(OC)O[C@@]([C@@H]([C@@H](CO)O)O)([C@H](N)[C@@H](O)C1)[H]
Synonyms:- 2-Methoxyneuraminic acid
- 2-O-Methyl-β-neuraminic acid
- 3-[2-amino-3,5-dihydroxy-6-(methoxymethyl)tetrahydro-2H-pyran-2-yl]-2,3-dihydroxypropanoic acid (non-preferred name)
- <span class="text-smallcaps">D</smallcap>-glycero-β-<smallcap>D</span>-galacto-2-Nonulopyranosidonic acid, methyl 5-amino-3,5-dideoxy-
- Methyl 5-amino-3,5-dideoxy-D-glycero-beta-D-galacto-2-nonulopyranosidonic acid
- Methyl β-neuraminoside
- β-Neuraminic acid, 2-O-methyl-
- D-glycero-β-D-galacto-2-Nonulopyranosidonic acid, methyl 5-amino-3,5-dideoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Methyl beta-Neuraminic Acid
CAS:Controlled ProductFormula:C10H19NO8Color and Shape:NeatMolecular weight:281.26Methyl β-neuraminic acid
CAS:Methyl β-neuraminic acid is a neuraminidase inhibitor that is used to treat influenza. It inhibits the action of the influenza virus by blocking its ability to attach to the host cell and enter. Methyl β-neuraminic acid has been shown to be effective in treating influenza A and B, with an efficacy of 92%. The drug is also effective against respiratory syncytial virus and adenovirus, as well as for prevention of flu in healthy adults. In addition, methyl β-neuraminic acid is able to prevent or reduce the severity of influenza when taken prophylactically. It can be administered orally or intravenously. Methyl β-neuraminic acid is often used as a synthetic reagent because it has both acetyl groups and hydroxyl groups. The optimum pH for this compound is 5.5-7.5 at room temperature.Formula:C10H19NO8Purity:Min. 95%Color and Shape:White PowderMolecular weight:281.26 g/mol


