CAS 56146-83-9
:Methyl (chlorosulfonyl)acetate
Description:
Methyl (chlorosulfonyl)acetate, with the CAS number 56146-83-9, is an organic compound characterized by its chlorosulfonyl functional group attached to an acetate moiety. It typically appears as a colorless to pale yellow liquid with a pungent odor. This compound is known for its reactivity, particularly in nucleophilic substitution reactions, due to the presence of the chlorosulfonyl group, which is a good leaving group. Methyl (chlorosulfonyl)acetate is soluble in organic solvents such as dichloromethane and ether but is less soluble in water. It is used in organic synthesis, particularly in the preparation of sulfonamide derivatives and other sulfonyl-containing compounds. Due to its reactive nature, it should be handled with care, as it can be corrosive and may cause irritation to the skin, eyes, and respiratory system. Proper safety precautions, including the use of personal protective equipment, are essential when working with this substance in a laboratory setting.
Formula:C3H5ClO4S
InChI:InChI=1/C3H5ClO4S/c1-8-3(5)2-9(4,6)7/h2H2,1H3
SMILES:COC(=O)CS(=O)(=O)Cl
Synonyms:- Acetic acid, 2-(chlorosulfonyl)-, methyl ester
- Chlorosulfonyl-acetic acid methyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Methyl 2-(Chlorosulfonyl)acetate
CAS:Formula:C3H5ClO4SPurity:95%Color and Shape:LiquidMolecular weight:172.5874Ref: IN-DA00355J
1g62.00€5g119.00€10g207.00€1kgTo inquire25g334.00€5kgTo inquire100mg26.00€250mg30.00€Methyl (chlorosulfonyl)acetate
CAS:<p>Methyl (chlorosulfonyl)acetate</p>Formula:C3H5ClO4SPurity:98%Color and Shape: clear. almost colourless liquidMolecular weight:172.59g/molMethyl 2-(chlorosulfonyl)acetate
CAS:<p>Methyl 2-(chlorosulfonyl)acetate is a chemical compound that has been shown to reduce the number of ovarian cells in mice. It has also been shown to have anti-inflammatory properties, as it inhibits the production of prostaglandin, which is a hormone that causes inflammation. Methyl 2-(chlorosulfonyl)acetate also has the ability to induce cell apoptosis and is being studied for its potential use as an anti-cancer agent. This chemical compound binds to chloride ions and ammonium nitrate ions and forms a carbanion. The carbanion can then react with hydrogen bonds with other molecules, forming new compounds. X-ray diffraction studies have revealed that methyl 2-(chlorosulfonyl)acetate binds to cancer cells through hydrogen bonds and kills the cells by causing them to undergo apoptosis, or programmed cell death.</p>Formula:C3H5SO4ClPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:172.59 g/molMETHYL 2-(CHLOROSULFONYL)ACETATE
CAS:Formula:C3H5ClO4SPurity:98%Color and Shape:LiquidMolecular weight:172.58Methyl (chlorosulfonyl)acetate
CAS:Controlled Product<p>Stability Moisture Sensitive<br>Applications Methyl (chlorosulfonyl)acetate<br></p>Formula:C3H5ClO4SColor and Shape:NeatMolecular weight:172.59




