CAS 5616-65-9
:1,3-dithiolane-2-carboxylic acid
Description:
1,3-Dithiolane-2-carboxylic acid is a heterocyclic organic compound characterized by a five-membered ring containing two sulfur atoms and a carboxylic acid functional group. Its molecular structure features a dithiolane ring, which contributes to its unique chemical properties, including its potential reactivity and ability to form various derivatives. The presence of the carboxylic acid group enhances its solubility in polar solvents and allows for participation in acid-base reactions. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It exhibits moderate stability under standard conditions but may undergo oxidation or other transformations in the presence of strong oxidizing agents. 1,3-Dithiolane-2-carboxylic acid is of interest in organic synthesis and may serve as a building block for more complex molecules, particularly in the fields of medicinal chemistry and materials science. Its unique structure and functional groups make it a valuable compound for research and potential applications in various chemical processes.
Formula:C4H6O2S2
InChI:InChI=1/C4H6O2S2/c5-3(6)4-7-1-2-8-4/h4H,1-2H2,(H,5,6)
SMILES:C1CSC(C(=O)O)S1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
1,3-Dithiolane-2-carboxylic acid
CAS:<p>1,3-Dithiolane-2-carboxylic acid is an organic molecule with the chemical formula C4H4O4. It is a dithiolane carboxylic acid that has been used in the preparation of glyoxylic acid and its derivatives. 1,3-Dithiolane-2-carboxylic acid can be prepared from the condensation of acetaldehyde and ethyl formate to give diethyl acetal, followed by reaction with sodium bisulfite to yield ethyl thioacetate. This compound can also be prepared by alkylation of diethyl sulfide with propylene oxide or butanol. The esterification of 1,3-dithiolane-2-carboxylic acid yields glyoxylic acid. Preparative methods for this compound include the use of acetals and dithioacetals as sources.</p>Formula:C4H6O2S2Purity:Min. 95%Molecular weight:150.2 g/mol

