CAS 5617-74-3
:3-Oxabicyclo[3.1.0]hexane-2,4-dione
Description:
3-Oxabicyclo[3.1.0]hexane-2,4-dione, also known by its CAS number 5617-74-3, is a bicyclic organic compound characterized by a unique bicyclic structure that includes an oxygen atom in the ring system. This compound features a dione functional group, indicating the presence of two carbonyl (C=O) groups located at the 2 and 4 positions of the bicyclic framework. The bicyclic nature of the molecule contributes to its rigidity and potential reactivity, making it of interest in various chemical syntheses and applications. It is typically a colorless to pale yellow liquid or solid, depending on its state at room temperature. The compound may exhibit polar characteristics due to the carbonyl groups, influencing its solubility in polar solvents. Additionally, 3-Oxabicyclo[3.1.0]hexane-2,4-dione can participate in various chemical reactions, including nucleophilic additions and cycloadditions, making it a valuable intermediate in organic synthesis and medicinal chemistry. Its unique structure and reactivity profile make it a subject of interest in research and development.
Formula:C5H4O3
InChI:InChI=1/C5H4O3/c6-4-2-1-3(2)5(7)8-4/h2-3H,1H2
SMILES:C1C2C1C(=O)OC2=O
Synonyms:- 1,2-Cyclopropanedicarboxylic anhydride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Oxabicyclo[3.1.0]hexane-2,4-dione
CAS:Formula:C5H4O3Purity:>98.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:112.083-Oxabicyclo[3.1.0]hexane-2,4-dione
CAS:Formula:C5H4O3Purity:97%Color and Shape:SolidMolecular weight:112.0835Cyclopropane-1,2-dicarboxylic acid anhydride
CAS:Cyclopropane-1,2-dicarboxylic acid anhydrideFormula:C5H4O3Purity:98%Color and Shape: yellow solidMolecular weight:112.08g/mol3-Oxabicyclo[3.1.0]hexane-2,4-dione
CAS:Formula:C5H4O3Purity:95%Color and Shape:SolidMolecular weight:112.0843-Oxabicyclo[3.1.0]hexane-2,4-dione
CAS:3-Oxabicyclo[3.1.0]hexane-2,4-dione is a cocatalyst with a molecular formula of C6H14O3. It is a synthetic compound that is used as an inhibitor in organic synthesis reactions and as a cocatalyst for the ring-opening polymerization of cyclic olefins. 3-Oxabicyclo[3.1.0]hexane-2,4-dione binds to the receptor subtype site on the benzene ring of benzoate, amines, and acid catalysts. This binding prevents the formation of an enzyme/substrate complex at the active site of the enzyme, inhibiting its activity and leading to cell death.Purity:95%Nmr




