CAS 5617-84-5: α-Hydroxycyclopropaneacetic acid

Description:α-Hydroxycyclopropaneacetic acid, with the CAS number 5617-84-5, is an organic compound characterized by its unique cyclopropane structure and the presence of both hydroxyl and carboxylic acid functional groups. This compound typically appears as a white crystalline solid and is soluble in water due to the polar nature of its functional groups. The α-hydroxy group contributes to its reactivity, making it a potential candidate for various chemical reactions, including esterification and oxidation. Its cyclopropane ring imparts strain, which can influence its chemical behavior and stability. α-Hydroxycyclopropaneacetic acid is of interest in organic synthesis and may have applications in pharmaceuticals and agrochemicals. Additionally, its structural features may allow it to participate in biological processes, although specific biological activities would require further investigation. Overall, this compound exemplifies the intriguing chemistry associated with small cyclic structures and multifunctional groups.

Formula:C₅H₈O₃

InChI:InChI=1S/C5H8O3/c6-4(5(7)8)3-1-2-3/h3-4,6H,1-2H2,(H,7,8)

InChI key:InChIKey=WGYFYSOUPAKFHY-UHFFFAOYSA-N

SMILES:O=C(O)C(O)C1CC1

Synonyms:
Cyclopropaneacetic acid, α-hydroxy-
Cyclopropaneglycolic acid
2-Cyclopropyl-2-hydroxyacetic acid
Cyclopropylglycolic acid
α-Hydroxycyclopropaneacetic acid

Found 3 products.

Product data	Purity	Price range	Estimated delivery
2-cyclopropyl-2-hydroxyacetic acid REF: IN-DA01AGLPCAS: 5617-84-5	97%	To inquire	Thu 17 Apr 25
2-Cyclopropyl-2-hydroxyacetic acid REF: 10-F620007CAS: 5617-84-5	98+%	342.00 €~2,254.00 €	Tue 22 Apr 25
2-Cyclopropyl-2-hydroxyacetic acid REF: 3D-FAA61784CAS: 5617-84-5	Min. 95%	- - -	Discontinued product