CAS 56177-80-1
:2-Ethoxy-5-fluoro-4(3H)-pyrimidinone
Description:
2-Ethoxy-5-fluoro-4(3H)-pyrimidinone is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of an ethoxy group at the 2-position and a fluorine atom at the 5-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and is soluble in polar organic solvents due to the ethoxy group, which enhances its solubility profile. The fluorine substituent can influence the compound's reactivity and biological activity, making it of interest in pharmaceutical research. Additionally, the presence of the pyrimidinone moiety suggests potential applications in medicinal chemistry, particularly in the development of antiviral or anticancer agents. Its molecular structure allows for various chemical reactions, including nucleophilic substitutions and potential interactions with biological targets. As with many fluorinated compounds, it may exhibit enhanced metabolic stability and altered pharmacokinetics compared to its non-fluorinated counterparts.
Formula:C6H7FN2O2
InChI:InChI=1S/C6H7FN2O2/c1-2-11-6-8-3-4(7)5(10)9-6/h3H,2H2,1H3,(H,8,9,10)
InChI key:InChIKey=XREDGJFKPWBNRQ-UHFFFAOYSA-N
SMILES:O(CC)C=1NC(=O)C(F)=CN1
Synonyms:- 2-Ethoxy-5-fluoro-1,4-dihydropyrimidin-4-one
- 2-Ethoxy-5-fluoro-1H-pyrimidin-4-one
- 2-Ethoxy-5-fluoro-1H-pyrimidin-6-one
- 2-Ethoxy-5-fluoro-3,4-dihydropyrimidin-4-one
- 2-Ethoxy-5-fluoropyrimidin-4-ol
- 2-Ethoxy-5-fluorouracil
- 2-ethoxy-5-fluoropyrimidin-4(3H)-one
- 4(1H)-Pyrimidinone, 2-ethoxy-5-fluoro-
- 4(3H)-Pyrimidinone, 2-ethoxy-5-fluoro-
- 2-Ethoxy-5-fluoro-4(3H)-pyrimidinone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
FLUOROURACIL IMPURITY F CRS
CAS:FLUOROURACIL IMPURITY F CRSFormula:C6H7FN2O2Molecular weight:158.1304Fluorouracil Related Compound F (2-Ethoxy-5-fluoropyrimidin-4(1H)-one)
CAS:Compounds containing a pyrimidine ring, whether or not hydrogenated, or piperazine ring in the structure, nesoiFormula:C6H7FN2O2Color and Shape:White Off-White PowderMolecular weight:158.049162-Ethoxy-5-fluoropyrimidin-4(3H)-one
CAS:Formula:C6H7FN2O2Purity:98%Color and Shape:SolidMolecular weight:158.13042-Ethoxy-5-fluoropyrimidin-4(3H)-one
CAS:<p>2-Ethoxy-5-fluoropyrimidin-4(3H)-one</p>Formula:C6H7FN2O2Purity:98%Color and Shape: pale yellow solidMolecular weight:158.13g/molEthoxy-5-fluoro-4(3H)-pyrimidinone
CAS:Controlled Product<p>Impurity Fluorouracil EP Impurity F<br>Applications Ethoxy-5-fluoro-4(3H)-pyrimidinone (Fluorouracil EP Impurity F) is a derivative of 5-fluorouracil (3C,15N2 labelled, F596002) which is a potent antineoplastic agent in clinical use.<br>References Rudy, B.C., et al.: Anal. Profiles Drug Subs., 2, 221 (1973), Miyashita, O., et al.: Chem. Pharm. Bull., 29, 3181 (1981), Hansen, R.M., et al.: Cancer Invest., 9, 637 (1991),<br></p>Formula:C6H7FN2O2Color and Shape:NeatMolecular weight:158.132-Ethoxy-5-fluoro-1H-pyrimidin-4-one
CAS:<p>2-Ethoxy-5-fluoro-1H-pyrimidin-4-one is a chemical compound that can be synthesized in ethanol, ether, and ethyl formate. It is a white crystalline solid with a melting point of 164°C. The impurities are filtered out using filtration. This compound reacts with substance to produce crystallization. 2-Ethoxy-5-fluoro-1H-pyrimidin-4-one can also be synthesized by reacting trimethylamine and isourea.</p>Formula:C6H7FN2O2Purity:Min. 95%Color and Shape:PowderMolecular weight:158.13 g/mol










