CAS 5618-03-1
:3-Cyclopropylpropanoic acid
Description:
3-Cyclopropylpropanoic acid is an organic compound characterized by its cyclopropyl group attached to a propanoic acid backbone. It features a three-carbon chain with a carboxylic acid functional group (-COOH) at one end and a cyclopropyl ring at the third carbon position. This structure imparts unique properties, including potential for increased reactivity due to the strain in the cyclopropyl ring. The compound is typically a colorless to pale yellow liquid or solid, depending on temperature and purity. It is soluble in organic solvents and exhibits moderate solubility in water due to the polar carboxylic acid group. 3-Cyclopropylpropanoic acid may participate in various chemical reactions, including esterification and amidation, making it of interest in organic synthesis and medicinal chemistry. Its unique structure may also influence its biological activity, potentially leading to applications in pharmaceuticals or agrochemicals. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C6H10O2
InChI:InChI=1/C6H10O2/c7-6(8)4-3-5-1-2-5/h5H,1-4H2,(H,7,8)
SMILES:C1CC1CCC(=O)O
Synonyms:- Cyclopropanepropanoic acid
- 3-Cyclopropyl-Propionic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Cyclopropylpropionic Acid
CAS:Formula:C6H10O2Purity:97%Color and Shape:SolidMolecular weight:114.14243-Cyclopropylpropanoic acid
CAS:3-Cyclopropylpropanoic acidFormula:C6H10O2Purity:95%Color and Shape: colourless liquidMolecular weight:114.14g/mol3-Cyclopropylpropionic acid
CAS:Formula:C6H10O2Purity:97%Color and Shape:LiquidMolecular weight:114.1443-Cyclopropylpropanoic acid
CAS:3-Cyclopropylpropanoic acid is a synthetic derivative of oxalyl chloride. It has been shown to inhibit the growth of viruses, notably influenza A virus and human immunodeficiency virus (HIV), in cell culture. 3-Cyclopropylpropanoic acid also inhibits the g1 phase of the cell cycle. In addition, it has been shown to inhibit skin cancer and cardiovascular diseases in humans.Formula:C6H10O2Purity:95%NmrMolecular weight:114.14 g/mol



