
CAS 56185-25-2
:2,5-Diethoxy-4-nitrobenzenamine
Description:
2,5-Diethoxy-4-nitrobenzenamine, with the CAS number 56185-25-2, is an organic compound characterized by its aromatic structure featuring a nitro group and two ethoxy substituents. This compound typically appears as a solid at room temperature and is soluble in organic solvents due to the presence of the ethoxy groups, which enhance its hydrophobic character. The nitro group, being an electron-withdrawing group, influences the reactivity of the compound, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The presence of the amino group (-NH2) allows for further functionalization, making it useful in synthetic organic chemistry. Additionally, the compound may exhibit specific biological activities, which can be explored in pharmaceutical research. Safety data should be consulted, as nitro compounds can sometimes be hazardous. Overall, 2,5-Diethoxy-4-nitrobenzenamine serves as an interesting subject for both academic research and industrial applications due to its unique structural features and reactivity.
Formula:C10H14N2O4
InChI:InChI=1S/C10H14N2O4/c1-3-15-9-6-8(12(13)14)10(16-4-2)5-7(9)11/h5-6H,3-4,11H2,1-2H3
InChI key:InChIKey=DPXZULKECUHOKO-UHFFFAOYSA-N
SMILES:O(CC)C1=C(N(=O)=O)C=C(OCC)C(N)=C1
Synonyms:- Benzenamine, 2,5-diethoxy-4-nitro-
- 2,5-Diethoxy-4-nitrobenzenamine
- Aniline, 2,5-diethoxy-4-nitro-
- 2,5-Diethoxy-4-nitroaniline
- 4-Nitro-2,5-diethoxyaniline
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery