CAS 56187-37-2
:3,5-Dichloro-4-oxo-1(4H)-pyridineacetic acid
Description:
3,5-Dichloro-4-oxo-1(4H)-pyridineacetic acid, with the CAS number 56187-37-2, is a chemical compound characterized by its pyridine ring structure, which is substituted at the 3 and 5 positions with chlorine atoms and features a carboxylic acid group. This compound exhibits acidic properties due to the presence of the carboxylic acid functional group, which can donate protons in solution. The dichloro substitutions contribute to its reactivity and potential biological activity, making it of interest in various chemical and pharmaceutical applications. The presence of the keto group (4-oxo) enhances its reactivity, potentially allowing for further chemical modifications. In terms of solubility, compounds of this nature typically exhibit moderate solubility in polar solvents, influenced by the functional groups present. Additionally, the compound may exhibit specific interactions with biological targets, which could be explored for therapeutic applications. Overall, 3,5-Dichloro-4-oxo-1(4H)-pyridineacetic acid is a versatile compound with potential utility in medicinal chemistry and related fields.
Formula:C7H5Cl2NO3
InChI:InChI=1S/C7H5Cl2NO3/c8-4-1-10(3-6(11)12)2-5(9)7(4)13/h1-2H,3H2,(H,11,12)
InChI key:InChIKey=MFMXEEQESUEMSB-UHFFFAOYSA-N
SMILES:C(C(O)=O)N1C=C(Cl)C(=O)C(Cl)=C1
Synonyms:- (3,5-dichloro-4-oxopyridin-1(4H)-yl)acetate
- (3,5-dichloro-4-oxopyridin-1(4H)-yl)acetic acid
- 1(4H)-Pyridineacetic acid, 3,5-dichloro-4-oxo-
- 2-(3,5-Dichloro-4-oxo-1,4-dihydropyridin-1-yl)acetic acid
- 2-(3,5-Dichloro-4-oxopyridin-1(4H)-yl)acetic acid
- 2-(3,5-Dichloro-4-oxopyridin-1-yl)acetic acid
- 3,5-Dichloro-4-Oxo-1-Pyridineacetic Acid
- 3,5-Dichloro-4-Pyridone-1-Acetic Acid
- 3,5-Dichloro-4-oxo-1(4H)-pyridineacetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3,5-Dichloro-4-pyridone-N-acetic acid
CAS:Formula:C7H5Cl2NO3Purity:98%Color and Shape:SolidMolecular weight:222.0255[3,5-Dichloro-4-oxopyridin-1(4H)-yl]acetic acid
CAS:[3,5-Dichloro-4-oxopyridin-1(4H)-yl]acetic acidFormula:C7H5Cl2NO3Purity:≥95%Color and Shape: white solidMolecular weight:222.03g/mol3,5-Dichloro-4-pyridone-1-acetic acid
CAS:3,5-Dichloro-4-pyridone-1-acetic acid is a chlorinated derivative of 7-aminocephalosporanic acid that is synthesized from hydrochloric acid and chloroacetic anhydride. It is used in the pharmaceutical industry as a reagent to produce medicines such as antibiotics and anti-inflammatory agents. The product yield of this reaction is high, which makes it an excellent choice for industrial use. 3,5-Dichloro-4-pyridone-1-acetic acid also has a low toxicity profile and can be easily degraded by bacteria in the environment.Formula:C7H5Cl2NO3Purity:Min. 95%Molecular weight:222.02 g/mol3,5-Dichloro-4-pyridone-N-acetic acid
CAS:Formula:C7H5Cl2NO3Purity:98%Color and Shape:SolidMolecular weight:222.023,5-Dichloro-4-pyridone-1-acetic acid
CAS:Controlled ProductApplications 3,5-Dichloro-4-pyridone-1-acetic acid
Formula:C7H5Cl2NO3Color and Shape:NeatMolecular weight:222.03





