CymitQuimica logo

CAS 56187-93-0

:

(E)-4-(2,3,4,5,6-pentadeuteriophenyl)but-3-en-2-one

Description:
(E)-4-(2,3,4,5,6-pentadeuteriophenyl)but-3-en-2-one is an organic compound characterized by its unique structural features and isotopic labeling. This compound belongs to the class of α,β-unsaturated ketones, which are known for their reactivity in various chemical reactions, including Michael additions and conjugate additions. The presence of the pentadeuteriophenyl group indicates that five hydrogen atoms in the phenyl ring are replaced with deuterium, making it a valuable compound for studies involving isotopic effects and tracing mechanisms in chemical reactions. The (E) configuration denotes that the substituents on the double bond are on opposite sides, which can influence the compound's physical and chemical properties, such as boiling point and reactivity. Additionally, the but-3-en-2-one moiety contributes to its potential applications in organic synthesis and medicinal chemistry. Overall, this compound serves as an important tool in research, particularly in the fields of organic chemistry and isotope labeling studies.
Formula:C10H5D5O
InChI:InChI=1/C10H10O/c1-9(11)7-8-10-5-3-2-4-6-10/h2-8H,1H3/b8-7+/i2D,3D,4D,5D,6D
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • 4-(Phenyl-d5)-3-buten-2-one

    Controlled Product
    CAS:

    Applications 4-(Phenyl-d5)-3-buten-2-one (cas# 56187-93-0) is a compound useful in organic synthesis.

    Formula:C102H5H5O
    Color and Shape:Neat
    Molecular weight:151.22

    Ref: TR-P319582

    5mg
    251.00€
    50mg
    1,685.00€