CAS 56196-65-7
:(3-methyl-4-oxo-1,3-thiazolidin-2-ylidene)acetonitrile
Description:
(3-methyl-4-oxo-1,3-thiazolidin-2-ylidene)acetonitrile, with the CAS number 56196-65-7, is a chemical compound characterized by its thiazolidine ring structure, which incorporates a thiazole moiety and a cyano group. This compound typically exhibits a yellow to brown color and is soluble in polar organic solvents. The presence of the thiazolidine ring contributes to its potential biological activity, making it of interest in medicinal chemistry. The oxo group and the cyano group enhance its reactivity, allowing for various chemical transformations. Additionally, the methyl group at the 3-position can influence its steric and electronic properties, affecting its interactions in chemical reactions. This compound may also exhibit specific optical properties due to its structural features, which can be relevant in applications such as drug design or material science. Overall, (3-methyl-4-oxo-1,3-thiazolidin-2-ylidene)acetonitrile is a versatile compound with potential applications in various fields, including pharmaceuticals and organic synthesis.
Formula:C6H6N2OS
InChI:InChI=1/C6H6N2OS/c1-8-5(9)4-10-6(8)2-3-7/h2H,4H2,1H3
SMILES:CN1C(=O)CSC1=CC#N
Synonyms:- (2Z)-(3-methyl-4-oxo-1,3-thiazolidin-2-ylidene)ethanenitrile
- (2Z)-(3-methyl-4-oxo-1,3-thiazolidin-2-ylidene)acetonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
