CAS 5621-01-2

3-(4-methylphenyl)-5-[(4-nitrobenzyl)sulfanyl]-4H-1,2,4-triazol-4-amine

Description:

3-(4-methylphenyl)-5-[(4-nitrobenzyl)sulfanyl]-4H-1,2,4-triazol-4-amine, with the CAS number 5621-01-2, is a chemical compound that belongs to the class of triazoles, which are five-membered heterocyclic compounds containing three nitrogen atoms. This particular compound features a triazole ring substituted with a 4-methylphenyl group and a 4-nitrobenzylthio group, contributing to its unique chemical properties. The presence of the nitro group suggests potential for reactivity and biological activity, while the sulfanyl group may enhance its solubility and interaction with biological targets. The compound's structure indicates it may exhibit various pharmacological activities, making it of interest in medicinal chemistry. Additionally, its molecular characteristics, such as polarity and potential for hydrogen bonding, can influence its behavior in biological systems and its application in drug development. Overall, this compound exemplifies the complexity and diversity of triazole derivatives in chemical research and pharmaceutical applications.

Formula: C₆H₈ClN₃

InChI: InChI=1/C16H15N5O2S/c1-11-2-6-13(7-3-11)15-18-19-16(20(15)17)24-10-12-4-8-14(9-5-12)21(22)23/h2-9H,10,17H2,1H3

SMILES: Cc1ccc(cc1)c1nnc(n1N)SCc1ccc(cc1)N(=O)=O

Synonyms:

• 6-chloro-N,2-dimethyl-4-pyrimidinamine
• 6-Chloro-N,2-diMethylpyriMidin-4-aMine
• 4-Pyrimidinamine, 6-chloro-N,2-dimethyl-

6-chloro-N,2-dimethyl-4-pyrimidinamine

CAS: 5621-01-2

Formula: C₆H₈ClN₃

Purity: 96%

Color and Shape: Solid

Molecular weight: 157.6008

Ref: IN-DA003N6N

6-Chloro-N,2-Dimethylpyrimidin-4-Amine

CAS: 5621-01-2

6-Chloro-N,2-Dimethylpyrimidin-4-Amine

Purity: 99%

Molecular weight: 157.60g/mol

Ref: 54-OR1012014

6-Chloro-N,2-dimethylpyrimidin-4-amine

CAS: 5621-01-2

Formula: C₆H₈ClN₃

Purity: 96%

Molecular weight: 157.6

Ref: 10-F517803