CAS 56219-04-6
:(Z)-9-Hexadecenal
Description:
(Z)-9-Hexadecenal, with the CAS number 56219-04-6, is an unsaturated aldehyde characterized by a long carbon chain and a double bond in the cis configuration. It consists of 16 carbon atoms, with the double bond located between the 9th and 10th carbon atoms from the aldehyde functional group. This compound is typically a colorless to pale yellow liquid at room temperature and has a distinctive fatty odor, often associated with natural sources like certain plant oils. Its molecular formula is C16H30O, and it exhibits properties typical of aldehydes, such as reactivity towards nucleophiles and the ability to undergo oxidation. (Z)-9-Hexadecenal is of interest in various fields, including fragrance and flavor industries, as well as in studies related to pheromones in insects. Additionally, it can serve as a precursor in organic synthesis, contributing to the development of more complex molecules. Its stability and reactivity can be influenced by environmental factors such as temperature and light exposure.
Formula:C16H30O
InChI:InChI=1S/C16H30O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17/h7-8,16H,2-6,9-15H2,1H3/b8-7-
InChI key:InChIKey=QFPVVMKZTVQDTL-FPLPWBNLSA-N
SMILES:C(/C=C\CCCCCC)CCCCCCC=O
Synonyms:- (9Z)-9-Hexadecenal
- (9Z)-hexadec-9-enal
- (Z)-9-Hexadecenal
- 9-Hexadecenal, (9Z)-
- 9-Hexadecenal, (Z)-
- Palmitolealdehyde
- Z9-Hexadecenal
- cis-9-Hexadecenal
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
cis-9-Hexadecenal
CAS:Formula:C16H30OPurity:≥ 95.0%Color and Shape:Colourless to yellow liquidMolecular weight:238.41(Z)-9-Hexadecenal
CAS:<p>(Z)-9-Hexadecenal is an organic compound that is used as a pheromone in the species of bark beetles. It has been shown to inhibit the growth of other fungi, including opportunistic fungal pathogens. This activity may be due to its ability to bind and activate specific receptors on the surface of inflammatory cells, leading to an increase in cytokine production and expression of proinflammatory genes. (Z)-9-Hexadecenal also has anti-inflammatory properties against physiological activities such as growth factor binding experiments and solid phase microextraction studies. (Z)-9-Hexadecenal binds to lysine residues, inhibiting hydrogen bonding between amino acid residues and promoting population growth inhibition.</p>Formula:C16H30OPurity:Min. 90%Color and Shape:Colorless Clear LiquidMolecular weight:238.41 g/mol





