CAS 5622-34-4

6-Quinoline acetic acid

Description:

6-Quinoline acetic acid is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. This compound features an acetic acid functional group attached to the sixth position of the quinoline ring. It is typically a white to off-white crystalline solid, soluble in polar organic solvents, and exhibits moderate solubility in water. The presence of both the quinoline and carboxylic acid functionalities contributes to its potential biological activity, making it of interest in medicinal chemistry. 6-Quinoline acetic acid may exhibit properties such as antimicrobial, anti-inflammatory, or antitumor activities, although specific biological effects can vary based on structural modifications and the context of use. Additionally, it can participate in various chemical reactions, including esterification and amidation, making it a versatile intermediate in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₁H₉NO₂

InChI: InChI=1/C11H9NO2/c13-11(14)7-8-3-4-10-9(6-8)2-1-5-12-10/h1-6H,7H2,(H,13,14)

SMILES: c1cc2cc(ccc2nc1)CC(=O)O

Synonyms:

• Quinolin-6-Ylacetic Acid
• 6-Quinolineacetic Acid

2-(Quinolin-6-yl)acetic acid

CAS: 5622-34-4

Formula: C₁₁H₉NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 187.1947

Ref: IN-DA0034DJ

6-Quinolineacetic acid

CAS: 5622-34-4

6-Quinolineacetic acid

Purity: 95%

Molecular weight: 187.19g/mol

Ref: 54-OR350332

2-(Quinolin-6-yl)acetic acid

CAS: 5622-34-4

Formula: C₁₁H₉NO₂

Purity: 98%

Color and Shape: Solid, Yellow powder

Molecular weight: 187.198

Ref: 10-F079502