CAS 56222-03-8
:3,8-Dihydroxy-15,16,17-trimethoxytricyclo[12.3.1.12,6]nonadeca-1(18),2,4,6(19),14,16-hexaen-9-one
Description:
3,8-Dihydroxy-15,16,17-trimethoxytricyclo[12.3.1.12,6]nonadeca-1(18),2,4,6(19),14,16-hexaen-9-one, with the CAS number 56222-03-8, is a complex organic compound characterized by its unique tricyclic structure and multiple functional groups. This compound features three methoxy groups and two hydroxyl groups, which contribute to its chemical reactivity and potential biological activity. The presence of conjugated double bonds within its hexatriene system suggests that it may exhibit interesting optical properties, such as UV-Vis absorption. The hydroxyl groups can participate in hydrogen bonding, influencing its solubility and interaction with other molecules. Additionally, the compound's intricate stereochemistry may affect its pharmacological properties, making it a subject of interest in medicinal chemistry. Overall, this substance exemplifies the diversity of organic compounds and their potential applications in various fields, including pharmaceuticals and materials science. Further studies would be necessary to fully elucidate its properties and potential uses.
Formula:C22H26O6
InChI:InChI=1S/C22H26O6/c1-26-20-14-6-4-5-7-18(24)19(25)11-13-8-9-17(23)15(10-13)16(12-14)21(27-2)22(20)28-3/h8-10,12,19,23,25H,4-7,11H2,1-3H3
InChI key:InChIKey=IFQDEGDKLBEYHN-UHFFFAOYSA-N
SMILES:O(C)C1=C2C=3C=C(C=CC3O)CC(O)C(=O)CCCCC(=C2)C(OC)=C1OC
Synonyms:- 3,8-Dihydroxy-15,16,17-trimethoxytricyclo[12.3.1.12,6]nonadeca-1(18),2,4,6(19),14,16-hexaen-9-one
- (-)-Porson
- Tricyclo[12.3.1.12,6]nonadeca-1(18),2,4,6(19),14,16-hexaen-9-one, 3,8-dihydroxy-15,16,17-trimethoxy-
- Porsone
- Porson
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3,7-Dihydroxy-15,16,17-trimethoxytricyclo[12.3.1.12,6]nonadeca-1(18),2,4,6(19),14,16-hexen-9-one
CAS:Formula:C22H26O6Purity:98.0%Molecular weight:386.4382Porson
CAS:Porson exhibited anti-tubercular activity against Mycobacterium tuberculosis H37Rv in vitro and MICs values of 40.0 μg/mL.Formula:C22H26O6Purity:98%Color and Shape:SolidMolecular weight:386.44Porson
CAS:Controlled ProductPorson is a potent anticancer drug that belongs to the class of kinase inhibitors. It has been shown to induce apoptosis in human and Chinese hamster ovary tumor cell lines. Porson is an analog of vildagliptin, a drug used for the treatment of type 2 diabetes. This drug is excreted primarily through urine and has been found to bind to proteins in cancer cells, inhibiting their growth and proliferation. Porson selectively targets kinases involved in cancer cell signaling pathways, making it a promising candidate for cancer therapy. Its mechanism of action involves inhibition of protein synthesis, leading to cell death by disrupting the balance between pro- and anti-apoptotic factors.Formula:C22H26O6Purity:Min. 95%Molecular weight:386.4 g/mol



