CAS 56222-78-7

N-{[(3R)-5-chloro-8-hydroxy-3-methyl-1-oxo-3,4-dihydro-1H-isochromen-7-yl]carbonyl}-L-valine

Description:

N-{[(3R)-5-chloro-8-hydroxy-3-methyl-1-oxo-3,4-dihydro-1H-isochromen-7-yl]carbonyl}-L-valine, with the CAS number 56222-78-7, is a chemical compound that belongs to the class of amino acid derivatives. This substance features a valine amino acid moiety linked to a complex isoquinoline structure, which includes a chloro and hydroxy substituent, contributing to its potential biological activity. The presence of the carbonyl group indicates that it may participate in various chemical reactions, such as acylation or condensation. The stereochemistry of the compound is significant, as the (3R) configuration can influence its interaction with biological targets, potentially affecting its pharmacological properties. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of therapeutic agents. Its unique structure suggests potential applications in drug design, especially in targeting specific biological pathways. However, detailed studies on its solubility, stability, and biological activity would be necessary to fully understand its characteristics and potential uses.

Formula: C₁₆H₁₈ClNO₆

InChI: InChI=1/C16H18ClNO6/c1-6(2)12(15(21)22)18-14(20)9-5-10(17)8-4-7(3)24-16(23)11(8)13(9)19/h5-7,12,19H,4H2,1-3H3,(H,18,20)(H,21,22)/t7-,12+/m1/s1

Valyl-ochratoxin A

CAS: 56222-78-7

Valyl-ochratoxin A is a phenylalanyl moiety of ochratoxin A replaced by valine. It is a yeast valyl-tRNA synthetase inhibitor.

Formula: C₁₆H₁₈ClNO₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 355.77

Ref: TM-T26314