CAS 56223-89-3

2-{[4-nitro-2-(trifluoromethyl)phenyl]amino}ethanol

Description:

2-{[4-nitro-2-(trifluoromethyl)phenyl]amino}ethanol, with the CAS number 56223-89-3, is an organic compound characterized by its unique functional groups and structural features. It contains an amino group (-NH2) and a hydroxyl group (-OH) attached to a two-carbon ethanol backbone, which contributes to its classification as an amino alcohol. The presence of a nitro group (-NO2) and a trifluoromethyl group (-CF3) on the aromatic ring significantly influences its chemical reactivity and physical properties, such as solubility and polarity. The trifluoromethyl group often enhances the compound's lipophilicity, while the nitro group can impart electron-withdrawing characteristics, affecting its behavior in chemical reactions. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its stability, reactivity, and potential applications can vary based on the specific conditions and environments in which it is used. Overall, 2-{[4-nitro-2-(trifluoromethyl)phenyl]amino}ethanol is a complex molecule with diverse chemical properties.

Formula: C₉H₉F₃N₂O₃

InChI: InChI=1/C9H9F3N2O3/c10-9(11,12)7-5-6(14(16)17)1-2-8(7)13-3-4-15/h1-2,5,13,15H,3-4H2

SMILES: c1cc(c(cc1N(=O)=O)C(F)(F)F)NCCO

2-{[4-nitro-2-(trifluoromethyl)phenyl]amino}ethanol

CAS: 56223-89-3

Formula: C₉H₉F₃N₂O₃

Purity: 95.0%

Molecular weight: 250.177

Ref: 10-F315185