CAS 56236-74-9

4-sulfamoylbenzenecarbothioamide

Description:

4-Sulfamoylbenzenecarbothioamide, identified by its CAS number 56236-74-9, is an organic compound that features a sulfonamide functional group attached to a benzene ring, along with a carbothioamide moiety. This compound typically exhibits characteristics common to sulfonamides, such as potential antibacterial properties, due to the presence of the sulfonamide group, which can interfere with bacterial folic acid synthesis. The structure suggests it may have applications in medicinal chemistry, particularly in the development of pharmaceuticals. Its solubility and reactivity can vary based on the presence of functional groups, and it may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. The compound's stability, melting point, and other physical properties would depend on its specific molecular interactions and the environment in which it is studied. As with many sulfonamide derivatives, it may also exhibit biological activity, making it of interest for further research in drug development and therapeutic applications.

Formula: C₇H₈N₂O₂S₂

InChI: InChI=1/C7H8N2O2S2/c8-7(12)5-1-3-6(4-2-5)13(9,10)11/h1-4H,(H2,8,12)(H2,9,10,11)

SMILES: c1cc(ccc1C(=S)N)S(=O)(=O)N

4-Sulfamoylbenzene-1-carbothioamide

CAS: 56236-74-9

Versatile small molecule scaffold

Formula: C₇H₈N₂O₂S₂

Purity: Min. 95%

Molecular weight: 216.3 g/mol

Ref: 3D-GCA23674