CAS 56236-81-8

4-(methylsulfamoyl)benzenecarbothioamide

Description:

4-(Methylsulfamoyl)benzenecarbothioamide, with the CAS number 56236-81-8, is an organic compound characterized by the presence of a sulfonamide functional group and a thioamide group attached to a benzene ring. This compound typically exhibits properties associated with both sulfonamides and thioamides, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding due to the presence of nitrogen and sulfur atoms. The methylsulfamoyl group contributes to its chemical reactivity and may influence its biological activity, making it of interest in medicinal chemistry. The thioamide moiety can enhance the compound's stability and reactivity in various chemical reactions. Additionally, the presence of the aromatic benzene ring may impart certain electronic properties, affecting its interaction with other molecules. Overall, 4-(methylsulfamoyl)benzenecarbothioamide is a compound that may have applications in pharmaceuticals or agrochemicals, although specific biological activities would require further investigation.

Formula: C₈H₁₀N₂O₂S₂

InChI: InChI=1/C8H10N2O2S2/c1-10-14(11,12)7-4-2-6(3-5-7)8(9)13/h2-5,10H,1H3,(H2,9,13)

SMILES: CNS(=O)(=O)c1ccc(cc1)C(=S)N

4-(Methylsulfamoyl)benzene-1-carbothioamide

CAS: 56236-81-8

Versatile small molecule scaffold

Formula: C₈H₁₀N₂O₂S₂

Purity: Min. 95%

Molecular weight: 230.3 g/mol

Ref: 3D-GCA23681