CAS 5625-44-5
:3,6-di(propan-2-yl)piperazine-2,5-dione
Description:
3,6-Di(propan-2-yl)piperazine-2,5-dione, also known by its CAS number 5625-44-5, is a chemical compound characterized by its piperazine core structure, which features two isopropyl groups attached to the nitrogen atoms at positions 3 and 6. This compound belongs to the class of piperazine derivatives and is recognized for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the dione functional groups at positions 2 and 5 contributes to its reactivity and may influence its biological activity. Typically, compounds of this nature exhibit moderate to high solubility in organic solvents, while their solubility in water can vary depending on the specific substituents and their steric effects. The molecular structure suggests that it may engage in hydrogen bonding and other intermolecular interactions, which can affect its pharmacokinetic properties. As with many piperazine derivatives, it may also exhibit a range of biological activities, making it a subject of interest in drug discovery and development.
Formula:C10H18N2O2
InChI:InChI=1/C10H18N2O2/c1-5(2)7-9(13)12-8(6(3)4)10(14)11-7/h5-8H,1-4H3,(H,11,14)(H,12,13)
SMILES:CC(C)C1C(=NC(C(C)C)C(=N1)O)O
Synonyms:- 2,5-Piperazinedione, 3,6-Bis(1-Methylethyl)-
- 3,6-Diisopropylpiperazine-2,5-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
