CAS 5625-52-5
:1-methylpiperazine-2,5-dione
Description:
1-Methylpiperazine-2,5-dione, also known as N-methylpiperazine-2,5-dione, is a cyclic compound characterized by its piperazine ring structure with a methyl group and two carbonyl groups (diones) at the 2 and 5 positions. This compound is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to its ability to form hydrogen bonds. It exhibits basic properties due to the presence of the piperazine nitrogen atoms, which can participate in protonation reactions. The dione functional groups contribute to its reactivity, making it a potential intermediate in organic synthesis and pharmaceuticals. Additionally, 1-methylpiperazine-2,5-dione may exhibit biological activity, which can be explored for various applications in medicinal chemistry. Safety data indicates that, like many nitrogen-containing heterocycles, it should be handled with care, as it may pose health risks if ingested or inhaled. Overall, its unique structure and properties make it a compound of interest in both academic and industrial research.
Formula:C5H8N2O2
InChI:InChI=1/C5H8N2O2/c1-7-3-4(8)6-2-5(7)9/h2-3H2,1H3,(H,6,8)
SMILES:CN1CC(=NCC1=O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1 - Methylpiperazine - 2,5 - dione
CAS:Formula:C5H8N2O2Purity:97%Color and Shape:SolidMolecular weight:128.12921-METHYLPIPERAZINE-2,5-DIONE
CAS:Formula:C5H8N2O2Purity:97%Color and Shape:SolidMolecular weight:128.1311-Methylpiperazine-2,5-dione
CAS:1-Methylpiperazine-2,5-dione is a selective inhibitor of peptide transporter 2 (PEPT2). It has been shown to inhibit the uptake of 1-methylpiperazine by wild-type mice. This is due to its ability to coordinate with sodium ions and anionic sites in the gut. 1-Methylpiperazine-2,5-dione also binds to the transmembrane domain of PEPT2 and blocks the transport of peptides through the membrane. This drug may be useful as a radiotracer for imaging techniques such as X-ray diffraction or electron microscopy. It may also be used as an antispasmodic drug for treatments of gastrointestinal disorders.Formula:C5H8N2O2Purity:Min. 95%Molecular weight:128.13 g/mol



