CAS 56253-33-9: D-Glucose, 6-O-(2,3,4,6-tetra-O-acetyl-β-D-glucopyranosyl)-, 2,3,4-triacetate

Description: D-Glucose, 6-O-(2,3,4,6-tetra-O-acetyl-β-D-glucopyranosyl)-, 2,3,4-triacetate, with CAS number 56253-33-9, is a complex carbohydrate derivative characterized by its acetylated glucose units. This compound features multiple acetyl groups, which enhance its solubility and stability compared to unmodified glucose. The presence of the tetra-O-acetyl-β-D-glucopyranosyl moiety indicates that it is a glycoside, where the glucose unit is linked through a glycosidic bond. This structure contributes to its unique chemical properties, including its reactivity and potential applications in organic synthesis and biochemistry. The acetyl groups can be hydrolyzed under specific conditions, allowing for the release of the parent glucose molecules. This compound is typically used in research settings, particularly in studies involving carbohydrate chemistry and glycosylation reactions. Its physical properties, such as melting point and solubility, may vary based on the degree of acetylation and the presence of other functional groups. Overall, this compound exemplifies the complexity and versatility of carbohydrate derivatives in chemical applications.

Formula: C₂₆H₃₆O₁₈

InChI: InChI=1S/C26H36O18/c1-11(28)36-10-20-23(41-15(5)32)24(42-16(6)33)25(43-17(7)34)26(44-20)37-9-18(35)21(39-13(3)30)22(40-14(4)31)19(8-27)38-12(2)29/h8,18-26,35H,9-10H2,1-7H3/t18-,19+,20-,21-,22-,23-,24+,25-,26-/m1/s1

InChI key: InChIKey=FPZWADNOILZQPI-FGLALDNMSA-N

SMILES: O=CC(OC(=O)C)C(OC(=O)C)C(OC(=O)C)C(O)COC1OC(COC(=O)C)C(OC(=O)C)C(OC(=O)C)C1OC(=O)C

Synonyms:

• D-Glucose, 6-O-(2,3,4,6-tetra-O-acetyl-β-D-glucopyranosyl)-, 2,3,4-triacetate

6-O-(2,3,4,6-Tetra-O-acetyl-b-D-glucopyranosyl)-D-glucose 2,3,4-triacetate

CAS: 56253-33-9

2,3,4-Tri-O-acetyl-6-O-(2,3,4,6-tetra-O-acetyl-b-D-glucopyranosyl)-D-glucopyranose

CAS: 56253-33-9

Please enquire for more information about 2,3,4-Tri-O-acetyl-6-O-(2,3,4,6-tetra-O-acetyl-b-D-glucopyranosyl)-D-glucopyranose including the price, delivery time and more detailed …

• Formula: C₂₆H₃₆O₁₈
• Purity: Min. 95%
• Molecular weight: 636.55 g/mol