CAS 56257-31-9
:1-{(Z)-[(3S,9S,12S,15S)-15-amino-3-[(4R)-2-amino-3,4,5,6-tetrahydropyrimidin-4-yl]-9,12-bis(hydroxymethyl)-2,5,8,11,14-pentaoxo-1,4,7,10,13-pentaazacyclohexadecan-6-ylidene]methyl}urea
Description:
The chemical substance known as 1-{(Z)-[(3S,9S,12S,15S)-15-amino-3-[(4R)-2-amino-3,4,5,6-tetrahydropyrimidin-4-yl]-9,12-bis(hydroxymethyl)-2,5,8,11,14-pentaoxo-1,4,7,10,13-pentaazacyclohexadecan-6-ylidene]methyl}urea, with the CAS number 56257-31-9, is a complex organic compound characterized by its intricate structure that includes multiple functional groups and stereocenters. This compound features a pentaazacyclohexadecane core, which contributes to its potential biological activity and interaction with various biological targets. The presence of amino and hydroxymethyl groups suggests that it may participate in hydrogen bonding and other interactions, enhancing its solubility and reactivity. The stereochemistry indicated by the (S) and (R) designations implies that the molecule has specific spatial arrangements that could influence its pharmacological properties. Such compounds are often investigated for their potential therapeutic applications, particularly in fields like medicinal chemistry and drug design, due to their ability to mimic biological molecules or interact with biological pathways.
Formula:C19H31N11O8
InChI:InChI=1/C19H31N11O8/c20-7-3-24-17(37)12(8-1-2-23-18(21)29-8)30-14(34)9(4-25-19(22)38)26-15(35)11(6-32)28-16(36)10(5-31)27-13(7)33/h4,7-8,10-12,31-32H,1-3,5-6,20H2,(H,24,37)(H,26,35)(H,27,33)(H,28,36)(H,30,34)(H3,21,23,29)(H3,22,25,38)/b9-4-/t7-,8+,10-,11-,12-/m0/s1
Synonyms:- Cyclo[(2Z)-3-[(aminocarbonyl)amino]-2,3-didehydroalanyl-(2S)-2-[(4R)-2-amino-3,4,5,6-tetrahydro-4-pyrimidinyl]glycyl-(2S)-2-amino-β-alanyl-L-seryl-L-seryl]
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Tuberactinamine-N
CAS:<p>Tuberactinamine N is a biochemical compound that exhibits antibacterial activity comparable to that of its parent antibiotic.</p>Formula:C19H31N11O8Color and Shape:SolidMolecular weight:541.52
