CAS 56272-01-6
:L-Arabinofuranose, 1,2,3,5-tetraacetate
Description:
L-Arabinofuranose, 1,2,3,5-tetraacetate is a derivative of L-arabinofuranose, a naturally occurring sugar that is part of the pentose family. This compound is characterized by the presence of four acetyl groups attached to the hydroxyl groups of the sugar, which enhances its stability and solubility in organic solvents. The tetraacetate form is typically used in various chemical reactions and synthesis processes, particularly in carbohydrate chemistry. It exhibits properties typical of acetylated sugars, such as increased lipophilicity and altered reactivity compared to its parent sugar. The compound is often utilized in research and industrial applications, including the synthesis of glycosides and other carbohydrate derivatives. Its CAS number, 56272-01-6, allows for easy identification in chemical databases. As with many sugar derivatives, it may also exhibit biological activity, making it of interest in biochemical studies. Overall, L-arabinofuranose, 1,2,3,5-tetraacetate serves as a valuable compound in both synthetic and analytical chemistry contexts.
Formula:C13H18O9
InChI:InChI=1S/C13H18O9/c1-6(14)18-5-10-11(19-7(2)15)12(20-8(3)16)13(22-10)21-9(4)17/h10-13H,5H2,1-4H3/t10-,11-,12+,13?/m0/s1
InChI key:InChIKey=IHNHAHWGVLXCCI-ACJTYDJDSA-N
SMILES:O(C(C)=O)[C@@H]1[C@@H](OC(C)=O)C(OC(C)=O)O[C@H]1COC(C)=O
Synonyms:- 1,2,3,5-Tetra-O-acetyl-L-arabinofuranose
- L-Arabinofuranose, tetraacetate
- L-Arabinofuranose, 1,2,3,5-tetraacetate
- 1,2,3,5-Tetra-O-acetyl-L-arabinose
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Mixture of 1,2,3,5-Tetra-O-acetyl-L-arabinofuranose and Tetra-O-acetyl-α-L-arabinopyranose
CAS:Controlled ProductFormula:C13H18O9Color and Shape:NeatMolecular weight:636.5531,2,3,5-Tetra-O-acetyl-L-arabinofuranose
CAS:<p>1,2,3,5-Tetra-O-acetyl-L-arabinofuranose is an organic compound that belongs to the group of sugars. It is a component of many polysaccharides and glycoproteins. 1,2,3,5-Tetra-O-acetyl-L-arabinofuranose is a useful intermediate in the synthesis of lysine and theophylline. The most common method for deacetylation involves using triphenylphosphine and chlorine in dichloromethane or chloroform as solvent. This reaction yields 1,2,3,5-tetra-O-(chloroacetoxy)-L-arabinofuranose which can be purified by chromatography. The bioassay for 1,2,3,5-tetra-O-[chloroacetoxy]-L arabinofuranose was found to be similar to that for</p>Formula:C13H18O9Purity:Min. 95%Color and Shape:Colorless PowderMolecular weight:318.28 g/mol

