CAS 5628-44-4

4-Amino-2,3-dimethylbenzoic acid

Description:

4-Amino-2,3-dimethylbenzoic acid, also known as 4-amino-2,3-xylobenzoic acid, is an aromatic amino acid derivative characterized by the presence of an amino group (-NH2) and a carboxylic acid group (-COOH) attached to a benzene ring that is further substituted with two methyl groups at the 2 and 3 positions. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols, owing to its polar functional groups. It exhibits properties typical of amino acids, including the ability to participate in acid-base reactions due to its carboxylic acid group. The presence of the amino group allows for potential interactions in biological systems, making it of interest in pharmaceutical and biochemical research. Additionally, it may serve as an intermediate in organic synthesis or as a building block for more complex molecules. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₉H₁₁NO₂

InChI: InChI=1/C9H11NO2/c1-5-6(2)8(10)4-3-7(5)9(11)12/h3-4H,10H2,1-2H3,(H,11,12)

SMILES: Cc1c(C)c(ccc1C(=O)O)N

Synonyms:

• 4-Amino-2,3-dimethyl-benzoic acid

4-Amino-2,3-dimethylbenzoic acid

CAS: 5628-44-4

Formula: C₉H₁₁NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 165.1891

Ref: IN-DA003KO4

4-Amino-2,3-dimethylbenzoic acid

CAS: 5628-44-4

4-Amino-2,3-dimethylbenzoic acid

Purity: 98%

Molecular weight: 165.19g/mol

Ref: 54-OR90409

4-Amino-2,3-dimethylbenzoic acid

CAS: 5628-44-4

Formula: C₉H₁₁NO₂

Purity: 95%

Color and Shape: Liquid, No data available.

Molecular weight: 165.192

Ref: 10-F219369

4-Amino-2,3-dimethyl-benzoic acid

CAS: 5628-44-4

4-Amino-2,3-dimethyl-benzoic acid is a benzene derivative that has been detected in wastewater treatment plants at median concentrations of 3.2 μg/L. It is used as a sunscreen agent and can be found in sunscreens, cosmetics, and soaps. 4-Amino-2,3-dimethyl-benzoic acid has been shown to induce cancer in the skin of mice. This drug may also have effects on the production of reactive oxygen species that cause DNA mutations. 4DMBBA binds to proteins and nucleic acids by hydrogen bonding interactions with amino groups. The binding of 4DMBBA to DNA prevents the transcription of genes encoding proteins involved in DNA repair, leading to cell death and cancer.

Formula: C₉H₁₁NO₂

Purity: Min. 95%

Molecular weight: 165.19 g/mol

Ref: 3D-FAA62844