CymitQuimica logo

CAS 562803-76-3

:

1-[3-(1H-pyrazol-1-ylmethyl)phenyl]methanamine

Description:
1-[3-(1H-pyrazol-1-ylmethyl)phenyl]methanamine, with the CAS number 562803-76-3, is an organic compound characterized by its unique structure that includes a phenyl ring, a pyrazole moiety, and an amine group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the pyrazole ring may impart additional biological activity, making it of interest in medicinal chemistry. The compound's molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Its synthesis and characterization would involve standard organic chemistry techniques, including purification methods like recrystallization or chromatography. Additionally, the compound's stability, reactivity, and potential applications in drug development or as a chemical probe would be areas of interest for further research. Overall, this compound represents a class of organic molecules that may have significant implications in pharmaceutical chemistry.
Formula:C11H13N3
InChI:InChI=1/C11H13N3/c12-8-10-3-1-4-11(7-10)9-14-6-2-5-13-14/h1-7H,8-9,12H2
InChI key:XKFHMAZBNKKNMT-UHFFFAOYSA-N
SMILES:c1cc(cc(c1)Cn1cccn1)CN
Synonyms:
  • benzenemethanamine, 3-(1H-pyrazol-1-ylmethyl)-
Found 3 products.