CymitQuimica logo

CAS 562823-84-1

:

{4-[(2E)-3-(4-iodophenyl)prop-2-enoyl]phenyl}boronic acid

Description:
{4-[(2E)-3-(4-iodophenyl)prop-2-enoyl]phenyl}boronic acid, with the CAS number 562823-84-1, is a boronic acid derivative characterized by the presence of a boron atom bonded to a phenyl group and an enoyl moiety. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the iodine substituent on the phenyl ring can enhance its reactivity and influence its electronic properties, potentially making it a candidate for use in targeted drug delivery or as a building block in the synthesis of more complex molecules. Additionally, the compound may exhibit unique solubility characteristics and stability profiles, which can be influenced by the functional groups present. Overall, its structural features suggest potential utility in both research and industrial applications, particularly in the development of new materials or pharmaceuticals.
Formula:C15H12BIO3
InChI:InChI=1/C15H12BIO3/c17-14-8-1-11(2-9-14)3-10-15(18)12-4-6-13(7-5-12)16(19)20/h1-10,19-20H/b10-3+
Synonyms:
  • boronic acid, B-[4-[(2E)-3-(4-iodophenyl)-1-oxo-2-propen-1-yl]phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.