CAS 56287-63-9: Morpholine, 2-[(2-ethoxyphenoxy)methyl]-, hydrochloride, (R)-
Description:Morpholine, 2-[(2-ethoxyphenoxy)methyl]-, hydrochloride, (R)- is a chemical compound characterized by its morpholine ring structure, which is a six-membered heterocyclic compound containing one nitrogen atom. This specific derivative features an ethoxyphenoxy group, contributing to its unique properties and potential applications. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various formulations. The (R)- designation indicates that this compound exhibits chirality, meaning it has a specific three-dimensional arrangement that can influence its biological activity and interactions. Morpholine derivatives are often studied for their roles in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. The presence of the ethoxyphenoxy moiety may impart specific functional characteristics, such as increased lipophilicity or altered reactivity, which can be advantageous in drug development or chemical synthesis. Overall, this compound's unique structural features and properties make it a subject of interest in both research and industrial applications.
Formula:C13H19NO3·ClH
InChI:InChI=1S/C13H19NO3.ClH/c1-2-15-12-5-3-4-6-13(12)17-10-11-9-14-7-8-16-11;/h3-6,11,14H,2,7-10H2,1H3;1H/t11-;/m1./s1
InChI key:InChIKey=HJOCKFVCMLCPTP-RFVHGSKJSA-N
SMILES:Cl.O(C=1C=CC=CC1OCC2OCCNC2)CC
- Synonyms:
- (R)-2-(2-Ethoxyphenoxymethyl)tetrahydro-1,4-oxazine hydrochloride
- Morpholine, 2-[(2-ethoxyphenoxy)methyl]-, hydrochloride, (R)-
