CAS 56290-94-9
:Medroxalol
Description:
Medroxalol is a chemical compound classified as a non-selective beta-adrenergic antagonist, primarily used in the treatment of hypertension. It is characterized by its ability to block beta-adrenergic receptors, which plays a crucial role in regulating heart rate and blood pressure. Medroxalol exhibits a moderate lipophilicity, allowing it to penetrate biological membranes effectively. The compound has a relatively short half-life, necessitating multiple doses for sustained therapeutic effects. Its pharmacological profile includes potential side effects such as fatigue, dizziness, and gastrointestinal disturbances, which are common among beta-blockers. Medroxalol's mechanism of action involves the inhibition of catecholamine effects on the heart and vascular system, leading to decreased cardiac output and peripheral vascular resistance. Additionally, it may have some intrinsic sympathomimetic activity, which can influence its overall cardiovascular effects. As with any medication, the use of Medroxalol should be monitored by healthcare professionals to manage dosage and assess for any adverse reactions.
Formula:C20H24N2O5
InChI:InChI=1S/C20H24N2O5/c1-12(2-3-13-4-7-18-19(8-13)27-11-26-18)22-10-17(24)14-5-6-16(23)15(9-14)20(21)25/h4-9,12,17,22-24H,2-3,10-11H2,1H3,(H2,21,25)
InChI key:InChIKey=MPQWSYJGFLADEW-UHFFFAOYSA-N
SMILES:C(CC(NCC(O)C1=CC(C(N)=O)=C(O)C=C1)C)C=2C=C3C(=CC2)OCO3
Synonyms:- 260-099-3
- 5-(2-{[4-(1,3-Benzodioxol-5-Yl)Butan-2-Yl]Amino}-1-Hydroxyethyl)-2-Hydroxybenzamide
- 5-[2-[[3-(1,3-Benzodioxol-5-yl)-1-methylpropyl]amino]-1-hydroxyethyl]-2-hydroxybenzamide
- 56290-94-9
- Benzamide, 5-[2-[[3-(1,3-benzodioxol-5-yl)-1-methylpropyl]amino]-1-hydroxyethyl]-2-hydroxy-
- Rmi 81968
- Medroxalol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Medroxalol
CAS:Medroxalol (RMI81968), an oral α- & β-adrenergic blocker, has antihypertensive and vasodilatory effects.Formula:C20H24N2O5Color and Shape:SolidMolecular weight:372.42
