CymitQuimica logo

CAS 56305-66-9

:

4-amino-N-(6-oxo-1,6-dihydropyrimidin-2-yl)benzenesulfonamide

Description:
4-amino-N-(6-oxo-1,6-dihydropyrimidin-2-yl)benzenesulfonamide, with the CAS number 56305-66-9, is a chemical compound that features a sulfonamide functional group attached to a benzene ring, along with an amino group and a pyrimidine derivative. This compound is characterized by its potential biological activity, particularly in the realm of medicinal chemistry, where it may exhibit antibacterial or antitumor properties. The presence of the sulfonamide group is significant, as it is known for its role in various pharmaceutical applications, including the development of antibiotics. The pyrimidine moiety contributes to the compound's structural complexity and may influence its interaction with biological targets. Additionally, the compound's solubility, stability, and reactivity can be affected by the functional groups present, making it a subject of interest for further research in drug development and synthesis. Overall, this compound exemplifies the intersection of organic chemistry and pharmacology, highlighting the importance of structural features in determining biological activity.
Formula:C10H10N4O3S
InChI:InChI=1/C10H10N4O3S/c11-7-1-3-8(4-2-7)18(16,17)14-10-12-6-5-9(15)13-10/h1-6H,11H2,(H2,12,13,14,15)
SMILES:c1cc(ccc1N)S(=O)(=O)Nc1nccc(n1)O
Synonyms:
  • Benzenesulfonamide, 4-amino-N-(4-hydroxy-2-pyrimidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.