CAS 5631-35-6
:1-[4,4-Bis(4-fluorophenyl)butyl]piperazine
Description:
1-[4,4-Bis(4-fluorophenyl)butyl]piperazine, identified by its CAS number 5631-35-6, is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic structure containing two nitrogen atoms. This compound features a butyl chain substituted with two 4-fluorophenyl groups, contributing to its lipophilicity and potential biological activity. The presence of fluorine atoms enhances the compound's stability and may influence its interaction with biological targets. Typically, such compounds are studied for their pharmacological properties, including potential applications in neuropharmacology or as therapeutic agents. The molecular structure suggests that it may exhibit significant steric hindrance due to the bulky fluorophenyl groups, which can affect its binding affinity and selectivity for various receptors. Additionally, the compound's solubility, melting point, and reactivity would depend on its specific molecular interactions and the environment in which it is studied. Overall, 1-[4,4-Bis(4-fluorophenyl)butyl]piperazine represents a class of compounds that may have diverse applications in medicinal chemistry and drug development.
Formula:C20H24F2N2
InChI:InChI=1S/C20H24F2N2/c21-18-7-3-16(4-8-18)20(17-5-9-19(22)10-6-17)2-1-13-24-14-11-23-12-15-24/h3-10,20,23H,1-2,11-15H2
InChI key:InChIKey=XMRZXPIHMZRNQC-UHFFFAOYSA-N
SMILES:C(CCCN1CCNCC1)(C2=CC=C(F)C=C2)C3=CC=C(F)C=C3
Synonyms:- 1-[4,4-Bis(4-fluorophenyl)butyl]piperazine
- 1-(4,4-Bis(4-fluorophenyl)butyl)piperazine
- Piperazine, 1-[4,4-bis(4-fluorophenyl)butyl]-
- Piperazine, 1-[4,4-bis(p-fluorophenyl)butyl]-
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery