CAS 56310-18-0
:Di-t-butylchlorosilane
Description:
Di-t-butylchlorosilane is an organosilicon compound characterized by its unique structure, which includes a silicon atom bonded to two t-butyl groups and one chlorine atom. It typically appears as a colorless to pale yellow liquid and has a relatively low boiling point, making it volatile. This compound is known for its reactivity, particularly in the presence of moisture, where it can hydrolyze to form silanol and hydrochloric acid. Di-t-butylchlorosilane is often used as a silane coupling agent in various applications, including the modification of surfaces and the synthesis of silicone polymers. Its sterically hindered t-butyl groups provide stability and influence its reactivity, making it useful in organic synthesis and materials science. Safety precautions are necessary when handling this compound, as it can be corrosive and harmful if inhaled or ingested. Proper storage in a cool, dry place away from moisture is essential to maintain its integrity and prevent unwanted reactions.
Formula:C8H19ClSi
InChI:InChI=1/C8H19ClSi/c1-7(2,3)10(9)8(4,5)6/h10H,1-6H3
SMILES:CC(C)(C)[SiH](C(C)(C)C)Cl
Synonyms:- Di-tert-butylchlorosilane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
DI-t-BUTYLCHLOROSILANE
CAS:<p>Trialkylsilyl Blocking Agent<br>Used as a protecting group for reactive hydrogens in alcohols, amines, thiols, and carboxylic acids. Organosilanes are hydrogen-like, can be introduced in high yield, and can be removed under selective conditions. They are stable over a wide range of reaction conditions and can be removed in the presence of other functional groups, including other protecting groups. The tolerance of silylated alcohols to chemical transformations summary is presented in Table 1 of the Silicon-Based Blocking Agents brochure.<br>Di-tert-butylchlorosilane; Chloro-bis(1,1-dimethylethyl)silyl hydride<br>Used in selective silylation of internal alcohols or diolsSummary of selective deprotection conditions is provided in Table 7 through Table 20 of the Silicon-Based Blocking Agents brochure<br></p>Formula:C8H19ClSiColor and Shape:LiquidMolecular weight:178.78Di-tert-butylchlorosilane
CAS:<p>Di-tert-butylchlorosilane is a silicon compound that can be used as a reagent in organic synthesis. It is an oxidizing agent that converts guanine to guanosine and termini to transfer reactions. Triflic acid reacts with di-tert-butylchlorosilane to form trifluoromethanesulfonic acid, which is then reacted with a molecule of the desired product in a stepwise fashion to form the ligation product. The radical chain mechanism for this reaction starts with the oxidation of silicon by triflic acid. This reaction creates radicals on silicon atoms, which react with neighboring molecules and create new radicals. These radicals are responsible for the chain reaction that leads to the formation of products such as guanosine.</p>Formula:C8H19ClSiPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:178.77 g/mol


