CAS 56317-05-6

Kaempferol 3-O-(6′′-galloyl)-β-D-glucopyranoside

Description:

Kaempferol 3-O-(6′′-galloyl)-β-D-glucopyranoside is a flavonoid glycoside, a subclass of polyphenolic compounds known for their diverse biological activities. This compound features a kaempferol backbone, which is a flavonol, linked to a glucose molecule through a glycosidic bond, with a galloyl group attached at the 6′′ position. Its molecular structure contributes to its antioxidant properties, allowing it to scavenge free radicals and potentially mitigate oxidative stress in biological systems. Kaempferol derivatives are often studied for their anti-inflammatory, anticancer, and cardioprotective effects. The presence of the galloyl moiety enhances its bioactivity, making it of interest in pharmacological research. This compound is typically found in various plants, particularly in fruits and vegetables, and is associated with health benefits attributed to dietary flavonoids. Its solubility and stability can vary depending on environmental conditions, influencing its bioavailability and efficacy in biological systems. Overall, Kaempferol 3-O-(6′′-galloyl)-β-D-glucopyranoside represents a significant area of interest in natural product chemistry and nutraceutical research.

Formula: C₂₈H₂₄O₁₅

InChI: InChI=1S/C28H24O15/c29-12-3-1-10(2-4-12)25-26(22(36)19-14(31)7-13(30)8-17(19)41-25)43-28-24(38)23(37)21(35)18(42-28)9-40-27(39)11-5-15(32)20(34)16(33)6-11/h1-8,18,21,23-24,28-35,37-38H,9H2/t18-,21-,23+,24-,28+/m1/s1

InChI key: InChIKey=STMNAPXMGWBZSF-OAYLZIFXSA-N

SMILES: O(C1=C(OC=2C(C1=O)=C(O)C=C(O)C2)C3=CC=C(O)C=C3)[C@@H]4O[C@H](COC(=O)C5=CC(O)=C(O)C(O)=C5)[C@@H](O)[C@H](O)[C@H]4O

Synonyms:

• Kaempferol 3-O-(6′′-galloyl)-β-D-glucopyranoside
• 5,7-Dihydroxy-2-(4-hydroxyphenyl)-3-[[6-O-(3,4,5-trihydroxybenzoyl)-β-D-glucopyranosyl]oxy]-4H-1-benzopyran-4-one
• 4H-1-Benzopyran-4-one, 5,7-dihydroxy-2-(4-hydroxyphenyl)-3-[[6-O-(3,4,5-trihydroxybenzoyl)-β-D-glucopyranosyl]oxy]-
• Benzoic acid, 3,4,5-trihydroxy-, 6′-ester with 3-(β-D-glucopyranosyloxy)-5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one
• Astragalin 6′′-O-gallate

Kaempferol 3-O-(6''-galloyl)-β-D-glucopyranoside

CAS: 56317-05-6

Kaempferol 3-O-(6''-galloyl)-beta-D-glucopyranoside is a glucopyranoside that inhibits HIV-2 RNase H with an IC50 of 5.19 μM.

Formula: C₂₈H₂₄O₁₅

Purity: 99.91%

Color and Shape: Solid

Molecular weight: 600.48

Ref: TM-TN6600

Kaempferol 3-O-(6''-galloyl)-β-D-glucopyranoside

CAS: 56317-05-6

Kaempferol 3-O-(6''-galloyl)-β-D-glucopyranoside

Purity: ≥98%

Molecular weight: 600.48g/mol

Ref: 54-BUP00832

Kaempferol 3-o-(6''-galloyl)-beta-D-glucopyranoside

CAS: 56317-05-6

Kaempferol 3-o-(6''-galloyl)-beta-D-glucopyranoside is a flavonoid glycoside, which is a type of naturally occurring polyphenol compound. This molecule is typically derived from various plant sources, where it occurs as part of the plant's secondary metabolites. The unique structure of kaempferol, linked to a galloyl group via a glycosidic bond, contributes to its biological activity.

Formula: C₂₈H₂₄O₁₅

Purity: Min. 95%

Molecular weight: 600.50 g/mol

Ref: 3D-GCA31705