CAS 56317-15-8
:5,6,7,8-tetramethoxy-2H-chromen-2-one
Description:
5,6,7,8-tetramethoxy-2H-chromen-2-one, with the CAS number 56317-15-8, is a synthetic organic compound belonging to the flavonoid class, specifically a type of chromone. This compound features a chromone backbone substituted with four methoxy groups at the 5, 6, 7, and 8 positions, which significantly influences its chemical properties and biological activities. The presence of these methoxy groups enhances its solubility in organic solvents and may contribute to its antioxidant and anti-inflammatory properties. Typically, compounds of this nature exhibit a range of biological activities, including potential anticancer effects, making them of interest in pharmaceutical research. The molecular structure allows for various interactions with biological targets, and its stability is generally influenced by the methoxy substitutions. As with many flavonoids, it may also exhibit UV-absorbing properties, which can be useful in applications such as photoprotection in cosmetics. Overall, 5,6,7,8-tetramethoxy-2H-chromen-2-one is a compound of interest in both synthetic chemistry and medicinal applications.
Formula:C13H14O6
InChI:InChI=1/C13H14O6/c1-15-9-7-5-6-8(14)19-10(7)12(17-3)13(18-4)11(9)16-2/h5-6H,1-4H3
SMILES:COc1c2ccc(=O)oc2c(c(c1OC)OC)OC
Synonyms:- 5,6,7,8-Tetramethoxycoumarin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
5,6,7,8-Tetramethoxycoumarin
CAS:Formula:C13H14O6Purity:95%~99%Color and Shape:Cryst.Molecular weight:266.2495,6,7,8-Tetramethoxycoumarin
CAS:5,6,7,8-Tetramethoxycoumarin is a coumarin derivative, which is a type of organic compound naturally found in many plant species. This compound is often isolated from certain plant sources, particularly in species known for their pharmacologically active metabolites. Coumarin derivatives like this are of interest due to their potential biochemical properties and mechanisms of action, which may involve interactions with enzymes or cellular pathways.
Formula:C13H14O6Purity:Min. 95%Molecular weight:266.25 g/molRef: 3D-GCA31715
Discontinued product



