CAS 56317-21-6
:Moracin M
Description:
Moracin M, with the CAS number 56317-21-6, is a naturally occurring compound classified as a flavonoid, specifically a type of moracin, which is derived from the Moraceae family of plants. This compound is primarily known for its presence in the fruit of the mulberry tree and exhibits various biological activities, including antioxidant, anti-inflammatory, and potential anticancer properties. Moracin M has a complex chemical structure characterized by multiple hydroxyl groups, which contribute to its reactivity and ability to scavenge free radicals. Its solubility can vary depending on the solvent, typically being more soluble in organic solvents than in water. Research into Moracin M has highlighted its potential therapeutic applications, particularly in the fields of pharmacology and nutraceuticals, although further studies are necessary to fully understand its mechanisms of action and efficacy in clinical settings. Overall, Moracin M represents a significant area of interest in natural product chemistry and its implications for health and disease management.
Formula:C14H10O4
InChI:InChI=1S/C14H10O4/c15-10-2-1-8-5-13(18-14(8)7-10)9-3-11(16)6-12(17)4-9/h1-7,15-17H
InChI key:InChIKey=LHPRYOJTASOZGJ-UHFFFAOYSA-N
SMILES:OC=1C=C(C2=CC=3C(O2)=CC(O)=CC3)C=C(O)C1
Synonyms:- 1,3-Benzenediol, 5-(6-Hydroxy-2-Benzofuranyl)-
- 2-(3,5-Dihydroxyphenyl)-6-hydroxybenzofuran
- 5-(6-Hydroxy-2-benzofuranyl)-1,3-benzenediol
- 5-(6-Hydroxy-benzofuran-2-yl)-benzene-1,3-diol
- 6,3′,5′-Trihydroxy-2-phenylbenzofuran
- Moracin M
- Veraphenol
- 5-(6-Hydroxy-1-benzofuran-2-yl)benzene-1,3-diol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Moracin M
CAS:Moracin M, a phenolic compound found in the skin of Morus alba Linn., effectively inhibits phosphodiesterase-4 (PDE4), exhibiting IC50 values of 2.9 μM and 4.5Formula:C14H10O4Purity:99.86%Color and Shape:SolidMolecular weight:242.23Moracin M
CAS:Controlled ProductApplications Moracin M is a tyrosinase inhibitory polyphenols from roots of Morus Alba. It also showed hypoglycemic effect by reducing glucose levels and lipid peroxidation and increasing insulin levels in rats with streptozotocin-induced diabetes mellitus.
References Jeong, S. H., et al.: J. Agric. Food Chem., 57, 1195 (2009); Singab, A. N. B., et al.: J. Ethnopharmacol., 100, 333 (2005);Formula:C14H10O4Color and Shape:NeatMolecular weight:242.227




