CAS 5632-16-6
:4-(Bromomethyl)quinoline
Description:
4-(Bromomethyl)quinoline is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a bromomethyl group at the 4-position of the quinoline ring introduces both halogen and alkyl functionalities, which can influence its reactivity and interactions. This compound typically appears as a yellow to brown solid and is sparingly soluble in water but more soluble in organic solvents like ethanol and dichloromethane. It is often used in organic synthesis and medicinal chemistry due to its potential as a building block for more complex molecules. The bromomethyl group can serve as a reactive site for further chemical modifications, making it valuable in the development of pharmaceuticals and agrochemicals. Additionally, compounds like 4-(Bromomethyl)quinoline may exhibit biological activity, including antimicrobial or anticancer properties, although specific biological effects would depend on the context of its use and the presence of other functional groups in a given compound. Safety precautions should be observed when handling this substance due to the presence of bromine, which can be hazardous.
Formula:C10H8BrN
InChI:InChI=1S/C10H8BrN/c11-7-8-5-6-12-10-4-2-1-3-9(8)10/h1-6H,7H2
InChI key:InChIKey=QJQXVPCIRZUOIP-UHFFFAOYSA-N
SMILES:C(Br)C=1C2=C(N=CC1)C=CC=C2
Synonyms:- Lepidine, α-bromo-
- Quinoline, 4-(bromomethyl)-
- 4-(Bromomethyl)quinoline
- 4-Bromomethylquinoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

