
CAS 5634-34-4
:Ambuphylline
Description:
Ambuphylline, with the CAS number 5634-34-4, is a chemical compound that belongs to the class of xanthine derivatives, which are known for their bronchodilator properties. It is primarily used in the treatment of respiratory conditions such as asthma and chronic obstructive pulmonary disease (COPD) due to its ability to relax bronchial smooth muscle and improve airflow. Ambuphylline exhibits a moderate therapeutic index and is often administered in combination with other medications to enhance its efficacy. The compound is characterized by its solubility in water and organic solvents, which facilitates its formulation in various pharmaceutical preparations. Its mechanism of action involves the inhibition of phosphodiesterase, leading to increased levels of cyclic AMP, which contributes to bronchodilation. Additionally, Ambuphylline may have mild diuretic effects and can influence cardiac function. As with many medications, potential side effects may include gastrointestinal disturbances, nervousness, and cardiovascular effects, necessitating careful monitoring during use.
Formula:C7H8N4O2·C4H11NO
InChI:InChI=1S/C7H8N4O2.C4H11NO/c1-10-5-4(8-3-9-5)6(12)11(2)7(10)13;1-4(2,5)3-6/h3H,1-2H3,(H,8,9);6H,3,5H2,1-2H3
InChI key:InChIKey=SEIRRUDMPNNSCY-UHFFFAOYSA-N
SMILES:C(CO)(C)(C)N.O=C1C2=C(N(C)C(=O)N1C)N=CN2
Synonyms:- 1H-Purine-2,6-dione, 3,9-dihydro-1,3-dimethyl-, compd. with 2-amino-2-methyl-1-propanol (1:1)
- 1-Propanol, 2-amino-2-methyl-, compd. with 3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione (1:1)
- Theophylline, compd. with 2-amino-2-methyl-1-propanol (1:1)
- 1H-Purine-2,6-dione, 3,7-dihydro-1,3-dimethyl-, compd. with 2-amino-2-methyl-1-propanol (1:1)
- 1-Propanol, 2-amino-2-methyl-, compd. with theophylline (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ambuphylline
CAS:Ambuphylline (Bufylline) is a theophylline derivative and bronchodilator for asthma and lung disease research.Formula:C11H19N5O3Color and Shape:SolidMolecular weight:269.305
