CAS 56341-31-2

2-Bromo-9H-xanthen-9-one

Description:

2-Bromo-9H-xanthen-9-one, with the CAS number 56341-31-2, is an organic compound belonging to the xanthone family. It features a xanthone core structure, which is characterized by a fused benzopyranone system. The presence of a bromine atom at the 2-position of the xanthone ring significantly influences its chemical properties, including reactivity and solubility. This compound is typically a yellow to orange solid and is known for its potential applications in organic synthesis, fluorescence, and as a dye. It may exhibit photochemical properties, making it useful in various fields such as materials science and biochemistry. Additionally, the bromine substituent can enhance its reactivity in electrophilic substitution reactions. As with many xanthone derivatives, 2-Bromo-9H-xanthen-9-one may also display biological activity, although specific biological effects would require further investigation. Safety data should be consulted for handling and usage, as halogenated compounds can pose health risks.

Formula: C₁₃H₇BrO₂

InChI: InChI=1/C13H7BrO2/c14-8-5-6-12-10(7-8)13(15)9-3-1-2-4-11(9)16-12/h1-7H

SMILES: c1ccc2c(c1)c(=O)c1cc(ccc1o2)Br

Synonyms:

• 9H-Xanthen-9-one, 2-bromo-

2-Bromo-9H-xanthen-9-one

CAS: 56341-31-2

Formula: C₁₃H₇BrO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 275.0975

Ref: IN-DA003782

2-Bromo-9H-xanthen-9-one

CAS: 56341-31-2

2-Bromo-9H-xanthen-9-one

Purity: 98%

Molecular weight: 275.10g/mol

Ref: 54-OR80413

2-Bromo-9H-xanthen-9-one

CAS: 56341-31-2

Purity: 95.0%

Molecular weight: 275.10101318359375

Ref: 10-F223562

2-Bromoxanthone

Controlled Product

CAS: 56341-31-2

Formula: C₁₃H₇BrO₂

Color and Shape: Neat

Molecular weight: 275.098

Ref: TR-B689185