CAS 56341-39-0

6-Fluorooxindole

Description:

6-Fluorooxindole is a chemical compound characterized by its oxindole structure, which is a bicyclic compound containing both an indole and a ketone functional group. The presence of a fluorine atom at the 6-position of the oxindole ring significantly influences its chemical properties and biological activity. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents. 6-Fluorooxindole is of interest in medicinal chemistry due to its potential pharmacological applications, including its role as a building block in the synthesis of various bioactive molecules. The fluorine substitution can enhance lipophilicity and metabolic stability, making it a valuable candidate in drug development. Additionally, compounds related to oxindole derivatives have been studied for their anti-inflammatory, analgesic, and anticancer properties. As with many chemical substances, handling 6-fluorooxindole requires appropriate safety precautions due to its potential toxicity and reactivity.

Formula: C₈H₆FNO

InChI: InChI=1/C8H6FNO/c9-6-2-1-5-3-8(11)10-7(5)4-6/h1-2,4H,3H2,(H,10,11)

SMILES: c1cc(cc2c1CC(=N2)O)F

Synonyms:

• 6-Fluoro-2-oxindole
• 6-Fluoroindolin-2-One
• 6-fluoro-1,3-dihydro-2H-indol-2-one
• 6-Fluoro-2-Oxoindole

2H-Indol-2-one, 6-fluoro-1,3-dihydro-

CAS: 56341-39-0

Formula: C₈H₆FNO

Purity: 95%

Color and Shape: Solid

Molecular weight: 151.1377

Ref: IN-DA00IA2C

6-Fluorooxindole

CAS: 56341-39-0

6-Fluorooxindole

Formula: C₈H₆FNO

Purity: 98%

Color and Shape: pink solid

Molecular weight: 151.14g/mol

Ref: 54-PC1736

6-Fluorooxindole

CAS: 56341-39-0

Ref: 7W-GK3435

6-Fluorooxindole

CAS: 56341-39-0

Formula: C₈H₆FNO

Purity: 95%

Color and Shape: Solid

Molecular weight: 151.14

Ref: 10-F092394