CAS 56341-65-2
:(6R,8R,8aR)-6-benzyloxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol
Description:
The chemical substance with the name "(6R,8R,8aR)-6-benzyloxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol" and CAS number "56341-65-2" is a complex organic compound characterized by its unique bicyclic structure, which includes a pyran and dioxine moiety. This compound features multiple stereocenters, contributing to its specific three-dimensional configuration, which can influence its biological activity and interactions. The presence of a benzyloxy group and a phenyl group suggests potential for aromatic interactions, which may enhance its solubility and reactivity in organic solvents. Additionally, the hydroxyl groups at the 7 and 8 positions indicate that it may exhibit hydrogen bonding capabilities, affecting its physical properties such as melting point and solubility in polar solvents. The intricate structure of this compound may also suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity. However, detailed studies would be necessary to fully elucidate its properties and applications.
Formula:C20H22O6
InChI:InChI=1/C20H22O6/c21-16-17(22)20(23-11-13-7-3-1-4-8-13)25-15-12-24-19(26-18(15)16)14-9-5-2-6-10-14/h1-10,15-22H,11-12H2/t15?,16-,17?,18+,19?,20-/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Benzyl 4,6-O-benzylidine-β-D-galactopyranoside
CAS:<p>Benzyl 4,6-O-benzylidine-b-D-galactopyranoside is a benzoylated sugar. It is prepared by reacting benzoyl chloride with benzene and then with the sugar in an equimolar ratio. The reaction proceeds via a nucleophilic substitution at the 2' position of the sugar followed by an elimination of water. Benzyl 4,6-O-benzylidine-b-D-galactopyranoside reacts with dibutyltin to form a benzoylated tin compound that can be used as a catalyst for organic synthesis.</p>Formula:C20H22O6Purity:Min. 95%Color and Shape:White To Off-White SolidMolecular weight:358.39 g/molBenzyl 4,6-O-Benzylidene-b-D-galactopyranoside
CAS:Controlled ProductFormula:C20H22O6Color and Shape:NeatMolecular weight:358.39


