CAS 56343-48-7

N,N,6-Trimethyl-2-pyrazinamine

Description:

N,N,6-Trimethyl-2-pyrazinamine is an organic compound characterized by its pyrazine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms at the 1 and 4 positions. This compound features three methyl groups attached to the nitrogen atoms, specifically at the N,N, and 6 positions, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of nitrogen atoms, which can engage in hydrogen bonding. The compound's structure suggests potential applications in pharmaceuticals or agrochemicals, as pyrazine derivatives are often explored for their biological activities. Additionally, the presence of multiple methyl groups can influence its reactivity and stability, making it an interesting subject for further research in synthetic chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₇H₁₁N₃

InChI: InChI=1S/C7H11N3/c1-6-4-8-5-7(9-6)10(2)3/h4-5H,1-3H3

InChI key: InChIKey=RZRBRFXNSRYIEE-UHFFFAOYSA-N

SMILES: N(C)(C)C1=NC(C)=CN=C1

Synonyms:

• Pyrazinamine, N,N,6-trimethyl-
• N,N,6-Trimethyl-2-pyrazinamine
• 2-Pyrazinamine, N,N,6-trimethyl-
• 2-Dimethylamino-6-methylpyrazine