CAS 56346-57-7
:4-(4-Fluorobenzoyl)-Piperidine
Description:
4-(4-Fluorobenzoyl)-Piperidine, identified by its CAS number 56346-57-7, is a chemical compound characterized by its piperidine core substituted with a 4-fluorobenzoyl group. This compound typically exhibits a white to off-white crystalline solid appearance. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its structural features that may influence biological activity. The presence of the fluorobenzoyl moiety can enhance lipophilicity and metabolic stability, making it a candidate for further research in drug design. The compound's solubility and stability can vary depending on the solvent and environmental conditions, which are crucial for its application in various chemical reactions or biological assays. Additionally, safety data should be reviewed, as with any chemical, to understand its handling, toxicity, and environmental impact. Overall, 4-(4-Fluorobenzoyl)-Piperidine represents a significant structure in the realm of organic synthesis and pharmaceutical development.
Formula:C12H15NO
InChI:InChI=1/C12H15NO/c14-12(10-4-2-1-3-5-10)11-6-8-13-9-7-11/h1-5,11,13H,6-9H2
SMILES:c1ccc(cc1)C(=O)C1CCNCC1
Synonyms:- 4-(4-Fluoro-benzoyl)-piperidine
- Phenyl(Piperidin-4-Yl)Methanone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-(4-Fluorobenzoyl)piperidine
CAS:Formula:C12H14FNOPurity:97%Color and Shape:SolidMolecular weight:207.24414-(4-Fluorobenzoyl)piperidine
CAS:<p>4-(4-Fluorobenzoyl)piperidine</p>Molecular weight:207.24406g/mol4-(4-Fluorobenzoyl)piperidine
CAS:Formula:C12H14FNOPurity:97.0%Color and Shape:SolidMolecular weight:207.2484-(4-Fluorobenzoyl)piperidine
CAS:<p>4-(4-Fluorobenzoyl)piperidine is a 5-HT2A receptor antagonist that inhibits the binding of serotonin to the 5-HT2A receptor. It has been shown to produce an increase in dopamine and acetylcholine levels in brain tissue, as well as an inhibition of the release of serotonin from the nerve endings. This agent also blocks the binding of serotonin to the 5-HT1A receptor. 4-(4-Fluorobenzoyl)piperidine has been shown to inhibit uptake of serotonin into synaptosomes, but not into platelets or erythrocytes. This agent is also a 5-HT2C receptor antagonist and may be postulated as an antidepressant.</p>Formula:C12H14FNOPurity:Min. 95%Molecular weight:207.24 g/molRef: 3D-FF59818
Discontinued product




