CAS 5635-16-5

3,4-diphenylfuran-2(5H)-one

Description:

3,4-Diphenylfuran-2(5H)-one, with the CAS number 5635-16-5, is an organic compound characterized by its furan ring structure substituted with two phenyl groups and a carbonyl group. This compound typically exhibits a pale yellow to light brown appearance and is known for its aromatic properties due to the presence of the phenyl groups. It is a member of the class of compounds known as diketones, which can participate in various chemical reactions, including condensation and oxidation. The presence of the furan ring contributes to its potential reactivity and biological activity, making it of interest in medicinal chemistry and organic synthesis. Additionally, 3,4-diphenylfuran-2(5H)-one may exhibit fluorescence, which can be useful in various applications, including as a fluorescent probe in biochemical assays. Its solubility characteristics can vary, often being soluble in organic solvents while having limited solubility in water. Overall, this compound's unique structure and properties make it a subject of interest in both research and industrial applications.

Formula: C₁₆H₁₂O₂

InChI: InChI=1/C16H12O2/c17-16-15(13-9-5-2-6-10-13)14(11-18-16)12-7-3-1-4-8-12/h1-10H,11H2

SMILES: c1ccc(cc1)C1=C(c2ccccc2)C(=O)OC1

Synonyms:

• 3,4-Diphenyl-5H-furan-2-one

3,4-Diphenyl-5H-furan-2-one

CAS: 5635-16-5

3,4-Diphenyl-5H-furan-2-one

Purity: ≥90%

Molecular weight: 236.27g/mol

Ref: 54-BUP02046

3,4-Diphenyl-5H-furan-2-one

CAS: 5635-16-5

3,4-Diphenyl-5H-furan-2-one (3,4-diphenyl-2H-furan-5-one) is a marine derived natural products found in Aspergillus flavipes.

Formula: C₁₆H₁₂O₂

Purity: 98.63%

Color and Shape: Solid

Molecular weight: 236.27

Ref: TM-TN7144

3,4-Diphenyl-2,5-dihydrofuran-2-one

CAS: 5635-16-5

Purity: 95%

Molecular weight: 236.2700043

Ref: 10-F643110

3,4-Diphenyl-2,5-dihydrofuran-2-one

CAS: 5635-16-5

Versatile small molecule scaffold

Formula: C₁₆H₁₂O₂

Purity: Min. 95%

Molecular weight: 236.26 g/mol

Ref: 3D-FAA63516