CAS 563538-33-0
:4-(piperazin-1-ylcarbonyl)phenol
Description:
4-(Piperazin-1-ylcarbonyl)phenol is a chemical compound characterized by its phenolic structure, which includes a piperazine moiety linked through a carbonyl group. This compound typically exhibits properties associated with both aromatic and amine functionalities, making it potentially useful in various applications, including medicinal chemistry and drug development. The presence of the piperazine ring contributes to its ability to interact with biological targets, potentially influencing its pharmacological activity. The carbonyl group enhances the compound's reactivity, allowing for further chemical modifications. In terms of solubility, compounds of this nature often exhibit moderate solubility in polar solvents due to the hydroxyl group, while the piperazine ring may impart some degree of basicity. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be utilized for structural elucidation. Overall, 4-(piperazin-1-ylcarbonyl)phenol represents a versatile scaffold in organic synthesis and medicinal chemistry.
Formula:C11H14N2O2
InChI:InChI=1/C11H14N2O2/c14-10-3-1-9(2-4-10)11(15)13-7-5-12-6-8-13/h1-4,12,14H,5-8H2
SMILES:c1cc(ccc1C(=O)N1CCNCC1)O
Synonyms:- (4-Hydroxyphenyl)(piperazin-1-yl)methanone
- Methanone, (4-hydroxyphenyl)-1-piperazinyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(4-Hydroxy-phenyl)-piperazin-1-yl-methanone
CAS:Formula:C11H14N2O2Color and Shape:SolidMolecular weight:206.245
