
CAS 56358-09-9
:N-(2-Ethylhexyl)-1-[2-[2-methyl-4-[2-(2-methylphenyl)diazenyl]phenyl]diazenyl]-2-naphthalenamine
Description:
N-(2-Ethylhexyl)-1-[2-[2-methyl-4-[2-(2-methylphenyl)diazenyl]phenyl]diazenyl]-2-naphthalenamine, identified by CAS number 56358-09-9, is a synthetic organic compound characterized by its complex azo structure, which features multiple aromatic rings and diazenyl groups. This compound is typically used in dye applications due to its vibrant color properties, stemming from the presence of the azo functional group (-N=N-), which is known for its ability to absorb visible light. The presence of the naphthalenamine moiety contributes to its stability and solubility in organic solvents. Additionally, the branched alkyl chain (2-ethylhexyl) enhances its hydrophobic characteristics, making it suitable for various applications in the textile and plastics industries. However, like many azo compounds, it may raise environmental and health concerns, particularly regarding its potential to release aromatic amines upon degradation. Therefore, handling and disposal must adhere to safety regulations to mitigate any risks associated with its use.
Formula:C32H37N5
InChI:InChI=1S/C32H37N5/c1-5-7-13-25(6-2)22-33-31-19-17-26-14-9-10-15-28(26)32(31)37-36-30-20-18-27(21-24(30)4)34-35-29-16-11-8-12-23(29)3/h8-12,14-21,25,33H,5-7,13,22H2,1-4H3
InChI key:InChIKey=HQAXWOAOPDPYHY-UHFFFAOYSA-N
SMILES:N(=NC1=C(C)C=C(N=NC2=C(C)C=CC=C2)C=C1)C=3C4=C(C=CC3NCC(CCCC)CC)C=CC=C4
Synonyms:- 2-Naphthalenamine, N-(2-ethylhexyl)-1-[2-[2-methyl-4-[2-(2-methylphenyl)diazenyl]phenyl]diazenyl]-
- N-(2-Ethylhexyl)-1-[2-[2-methyl-4-[2-(2-methylphenyl)diazenyl]phenyl]diazenyl]-2-naphthalenamine
- 2-Naphthalenamine, N-(2-ethylhexyl)-1-[[2-methyl-4-[(2-methylphenyl)azo]phenyl]azo]-
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery