CAS 56358-59-9

Ethyl 6-methyl-2-naphthalenecarboxylate

Description:

Ethyl 6-methyl-2-naphthalenecarboxylate, with the CAS number 56358-59-9, is an organic compound belonging to the class of naphthalene derivatives. It features a naphthalene ring system substituted with a carboxylate group and an ethyl group, contributing to its unique chemical properties. This compound is typically characterized by its aromatic structure, which imparts stability and distinctive reactivity patterns. Ethyl 6-methyl-2-naphthalenecarboxylate is generally a colorless to pale yellow liquid with a pleasant odor, making it useful in various applications, including as a flavoring agent or in the synthesis of other organic compounds. Its solubility in organic solvents, such as ethanol and ether, allows for ease of handling in laboratory settings. Additionally, the presence of the ethyl group enhances its lipophilicity, which can influence its biological activity and interactions. As with many organic compounds, safety precautions should be observed when handling this substance, as it may pose health risks if ingested or inhaled.

Formula: C₁₄H₁₄O₂

InChI: InChI=1S/C14H14O2/c1-3-16-14(15)13-7-6-11-8-10(2)4-5-12(11)9-13/h4-9H,3H2,1-2H3

InChI key: InChIKey=KIAAMEWGCAGZAA-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=CC2=C(C=C1)C=C(C)C=C2

Synonyms:

• 2-Naphthalenecarboxylic acid, 6-methyl-, ethyl ester
• 2-Naphthoic acid, 6-methyl-, ethyl ester
• Ethyl 6-methyl-2-naphthalenecarboxylate