CAS 56377-67-4

9-hydroxy-6,10-dimethyl-3-methylidene-2-oxododecahydro-6,9-epoxycyclodeca[b]furan-4-yl 2-methylpropanoate

Description:

9-Hydroxy-6,10-dimethyl-3-methylidene-2-oxododecahydro-6,9-epoxycyclodeca[b]furan-4-yl 2-methylpropanoate, with CAS number 56377-67-4, is a complex organic compound characterized by its unique structural features, including multiple functional groups and a bicyclic framework. This substance contains hydroxyl, epoxy, and ester functionalities, which contribute to its reactivity and potential applications in various fields, such as pharmaceuticals or agrochemicals. The presence of multiple methyl groups suggests that it may exhibit hydrophobic properties, influencing its solubility and interaction with biological systems. Additionally, the epoxy group indicates potential for further chemical transformations, making it a versatile intermediate in synthetic chemistry. Its structural complexity may also impart specific stereochemical properties, which can affect its biological activity. Overall, this compound exemplifies the intricate nature of organic molecules, where variations in structure can lead to diverse chemical behaviors and applications.

Formula: C₁₉H₂₈O₆

InChI: InChI=1/C19H28O6/c1-10(2)16(20)24-14-9-18(5)6-7-19(22,25-18)11(3)8-13-15(14)12(4)17(21)23-13/h10-11,13-15,22H,4,6-9H2,1-3,5H3

SMILES: CC(C)C(=O)OC1CC2(C)CCC(C(C)CC3C1C(=C)C(=O)O3)(O)O2

Tirotundin

CAS: 56377-67-4

Tirotundin: PPARα/γ agonist, anti-diabetic via PPARγ, reduces inflammation by blocking NF-kappa B activation.

Formula: C₁₉H₂₈O₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 352.427

Ref: TM-TN5149

Tirotundin

CAS: 56377-67-4

Formula: C₁₉H₂₈O₆

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 352.427

Ref: BP-SBP00950

Tirotundin

CAS: 56377-67-4

Tirotundin is an indolizidine alkaloid, which is derived from the plant genus *Elaeocarpus*. Its mode of action involves the inhibition of specific cell-signaling pathways that are crucial for tumor growth and proliferation. Specifically, tirotundin interferes with pathways that regulate cell cycle progression and apoptosis, thereby inducing cell death in cancerous cells.

Formula: C₁₉H₂₈O₆

Purity: Min. 95%

Molecular weight: 352.4 g/mol

Ref: 3D-GCA37767