
CAS 5638-84-6
:5,5-Diethyl-2,4-oxazolidinedione
Description:
5,5-Diethyl-2,4-oxazolidinedione, with the CAS number 5638-84-6, is a cyclic compound characterized by its oxazolidinedione structure, which features a five-membered ring containing both nitrogen and oxygen atoms. This compound typically appears as a white to off-white crystalline solid and is known for its stability under standard conditions. It is soluble in organic solvents, such as ethanol and acetone, but has limited solubility in water. The presence of the diethyl groups contributes to its lipophilicity, influencing its reactivity and interaction with biological systems. 5,5-Diethyl-2,4-oxazolidinedione is often studied for its potential applications in medicinal chemistry, particularly as a precursor in the synthesis of various pharmaceuticals. Its unique structural features allow for diverse chemical modifications, making it a valuable compound in organic synthesis. Additionally, it may exhibit biological activity, although specific pharmacological properties would require further investigation to fully understand its potential uses and mechanisms of action.
Formula:C7H11NO3
InChI:InChI=1S/C7H11NO3/c1-3-7(4-2)5(9)8-6(10)11-7/h3-4H2,1-2H3,(H,8,9,10)
InChI key:InChIKey=LANUZOBKRIJYEJ-UHFFFAOYSA-N
SMILES:C(C)C1(CC)OC(=O)NC1=O
Synonyms:- 2,4-Oxazolidinedione, 5,5-diethyl-
- 5,5-Diethyl-2,4-oxazolidinedione
- NSC 26554
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery